BindingDB logo
myBDB logout

18 SMILES Strings for Monocarboxylate transporter 4

Compound NameSMILES String
BDBM50442701 Oc1ccc(\C=C(/C#N)C([O-])=O)cc1
BDBM50442702 OC(=O)c1cc2ccc(cc2oc1=O)N1CCCC1
BDBM50442703 COc1ccc2c(C)c(C(O)=O)c(=O)oc2c1
BDBM50442704 Cc1c(C(O)=O)c(=O)oc2cc(OCc3ccccc3)ccc12
BDBM50442705 Cc1c(C(O)=O)c(=O)oc2cc(O)ccc12
BDBM50442706 OC(=O)c1cc2ccc(OCc3ccccc3)cc2n(Cc2ccccc2)c1=O
BDBM50442707 CCn1c2cc(OCc3ccccc3)ccc2cc(C(O)=O)c1=O
BDBM50442708 Cn1c2cc(OCc3ccccc3)ccc2cc(C(O)=O)c1=O
BDBM50442709 OC(=O)c1cc2ccc(OCc3ccccc3)cc2[nH]c1=O
BDBM50442710 CCN(CC)c1ccc2cc(C(O)=O)c(=O)oc2c1
BDBM50442711 CN(Cc1ccccc1)c1ccc2cc(C(O)=O)c(=O)oc2c1
BDBM50442712 OC(=O)c1cc2ccc(cc2oc1=O)N1CCOCC1
BDBM50442713 OC(=O)c1cc2ccc(OCCc3ccccc3)cc2oc1=O
BDBM50442714 COc1ccc2cc(C(O)=O)c(=O)oc2c1
BDBM50442715 OC(=O)c1cc2ccc(OCc3ccccc3)cc2oc1=O
BDBM50442716 CN(C)c1ccc2cc(C(O)=O)c(=O)oc2c1
BDBM50442717 OC(=O)c1cc2ccc(OCc3ccc(F)cc3)cc2oc1=O
BDBM50442718 OC(=O)c1cc2cc3CCCN4CCCc(c34)c2oc1=O