BindingDB logo
myBDB logout

9 SMILES Strings for Mu opioid receptor-like OR2

Compound NameSMILES String
BDBM50000092 CN1CC[C@@]23[C@H]4Oc5c2c(C[C@@H]1[C@@H]3C=C[C@@H]4O)ccc5O |r,c:16,TLB:13:12:8.9.10:3.2.1|
BDBM50116081 Cl.[H][C@@]12CCC[C@@]([H])(NCC1)[C@@H]2C(=O)OC |r,THB:12:11:3.5.4:8.10.9|
BDBM50116153 Cl.[H][C@]12CCC[C@]([H])([C@@H]1C(=O)OC)N(Cc1ccccc1)CC2 |r,TLB:14:13:8:3.5.4|
BDBM50116155 Cl.[H][C@@]12CCC[C@@]([H])(NCC1)[C@@H]2C(=O)Oc1ccccc1 |r,THB:12:11:3.5.4:8.10.9|
BDBM50116163 Cl.[H][C@@]12CCC[C@@]([H])(NCC1)[C@@H]2C(=O)Oc1ccc(O)cc1 |r,THB:12:11:3.5.4:8.10.9|
BDBM50116168 Cl.[H][C@@]12CCC[C@@]([H])(NCC1)[C@@H]2C(=O)N[C@@H](Cc1ccccc1)C(=O)OC |r,THB:12:11:3.5.4:8.10.9|
BDBM50116156 Cl.[H][C@]12CCC[C@]([H])([C@@H]1C(=O)OC)N(CCc1ccccc1)CC2 |r,TLB:14:13:8:3.5.4|
BDBM50116158 Cl.[H][C@@]12CCC[C@@]([H])(NCC1)[C@@H]2C(=O)Oc1cccc(O)c1 |r,THB:12:11:3.5.4:8.10.9|
BDBM50116169 Cl.[H][C@]12CCC[C@]([H])([C@@H]1C(=O)OC)N(CC2)C(=O)[C@@H](N)Cc1ccccc1 |r,TLB:16:13:8:3.5.4|