BindingDB logo
myBDB logout

5 SMILES Strings for Mucosal addressin cell adhesion molecule-1

Compound NameSMILES String
BDBM50070605 CC(C)C[C@H](NC(C)=O)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H]([C@@H](C)O)C(N)=O
BDBM50291322 CC(C)C[C@H](NC(C)=O)C(=O)NCC(CC(O)=O)S(=O)(=O)N[C@@H]([C@@H](C)O)C(N)=O
BDBM50291323 CC(C)C[C@H](NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC(C)C)NC(C)=O)[C@@H](C)O)C(N)=O
BDBM50291324 CC(C)C[C@H](NC(C)=O)C(=O)NCC(CC(O)=O)S(=O)(=O)N[C@@H](C(C)C)C(N)=O
BDBM50291325 CC(C)C[C@H](NC(C)=O)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](C(C)C)C(N)=O