BindingDB logo
myBDB logout

1 SMILES String for Multidrug Resistance Transporter MDR 1

Compound NameSMILES String
BDBM86757 COc1ccccc1N1CCN(CCCCn2ncc(=O)n(C)c2=O)CC1