BindingDB logo
myBDB logout

5 SMILES Strings for Multidrug resistance associated protein

Compound NameSMILES String
BDBM50375594 C[C@H](CCC(=O)NCCS(O)(=O)=O)[C@H]1CC[C@H]2[C@@H]3[C@H](O)C[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3C[C@H](O)[C@]12C |r|
BDBM50391002 CNc1nc2c(Cc3cccnc3)c(C)c(O[C@@H]3O[C@@H]([C@@H](O)[C@H](O)[C@H]3O)C(O)=O)c(C)c2s1
BDBM50391003 O[C@@H]1[C@@H](O)[C@H](OCc2cc(=O)oc3cc(O)ccc23)O[C@@H]([C@H]1O)C(O)=O |r|
BDBM50391004 N[C@@H](CCC(=O)N[C@H](CSc1ccc(cc1[N+]([O-])=O)[N+]([O-])=O)C(=O)NCC(O)=O)C(O)=O
BDBM18050 CN(Cc1cnc2nc(N)nc(N)c2n1)c1ccc(cc1)C(=O)N[C@@H](CCC(O)=O)C(O)=O |r|