BindingDB logo
myBDB logout

4 SMILES Strings for Multidrug resistance protein mdtK

Compound NameSMILES String
BDBM21690 OC(=O)c1cn(C2CC2)c2cc(N3CCNCC3)c(F)cc2c1=O
BDBM50045000 CCn1cc(C(O)=O)c(=O)c2cc(F)c(cc12)N1CCNCC1
BDBM50105463 CCn1c(-c2ccccc2)c2cc(N)ccc2c2ccc(=[NH2+])cc12
BDBM50336500 CCNc1cc2oc3c\c(=N/CC)c(C)cc3c(-c3ccccc3C(=O)OCC)c2cc1C |(-6.01,-19.07,;-4.68,-18.3,;-3.35,-19.07,;-2.01,-18.31,;-.68,-19.08,;.65,-18.3,;1.98,-19.07,;3.32,-18.3,;4.65,-19.07,;5.99,-18.3,;7.32,-19.07,;7.32,-20.61,;8.66,-21.38,;5.98,-16.75,;7.31,-15.98,;4.65,-15.99,;3.33,-16.76,;1.99,-15.98,;1.99,-14.45,;.66,-13.68,;.65,-12.15,;1.99,-11.37,;3.33,-12.14,;3.33,-13.68,;4.66,-14.45,;4.2,-15.5,;6.2,-14.46,;6.98,-13.13,;8.52,-13.14,;.65,-16.75,;-.68,-15.99,;-2.01,-16.76,;-3.34,-15.99,)|