BindingDB logo
myBDB logout

30 SMILES Strings for Multidrug translocase mdfA

Compound NameSMILES String
BDBM55038 CN(C)[C@H]1[C@@H]2[C@@H](O)[C@H]3C(C(=O)c4c(O)cccc4C3=C)C(=O)[C@]2(O)C(=O)C(C(N)=O)C1=O
BDBM50046492 CN(C)[C@H]1C2[C@@H](O)C3[C@@H](CSC4CCCC4)c4cccc(O)c4C(=O)C3C(=O)[C@]2(O)C(=O)C(C(=O)NCN2CCOCC2)C1=O
BDBM50046493 CN(C)[C@H]1C2[C@@H](O)C3[C@@H](CS(=O)Cc4ccccc4)c4cccc(O)c4C(=O)C3C(=O)[C@]2(O)C(=O)C(C(N)=O)C1=O
BDBM50046494 CN(C)[C@H]1C2CC3[C@@H](CSC4CCCC4)c4cccc(O)c4C(=O)C3C(=O)[C@]2(O)C(=O)C(C(N)=O)C1=O
BDBM50046495 CN(C)[C@H]1C2[C@@H](O)C3[C@@H](CSc4ccccc4)c4cccc(O)c4C(=O)C3C(=O)[C@]2(O)C(=O)C(C(N)=O)C1=O
BDBM50046496 CN(C)[C@H]1C2[C@@H](O)C3[C@@H](CSCCCCl)c4cccc(O)c4C(=O)C3C(=O)[C@]2(O)C(=O)C(C(N)=O)C1=O
BDBM50046497 CN(C)[C@H]1C2[C@@H](O)C3[C@@H](CSCc4ccc(Cl)cc4)c4cccc(O)c4C(=O)C3C(=O)[C@]2(O)C(=O)C(C(N)=O)C1=O
BDBM50046498 CN(C)[C@H]1C2[C@@H](O)C3[C@@H](CSc4ccc(Br)cc4)c4cccc(O)c4C(=O)C3C(=O)[C@]2(O)C(=O)C(C(N)=O)C1=O
BDBM50046499 CCCCSC[C@@H]1C2[C@H](O)C3[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C2C(=O)c2c(O)cccc12
BDBM50046501 CN(C)[C@H]1C2[C@@H](O)C3[C@@H](CSCc4ccccc4)c4cccc(O)c4C(=O)C3C(=O)[C@]2(O)C(=O)C(C(N)=O)C1=O
BDBM50046502 CN(C)[C@H]1C2[C@@H](O)C3[C@@H](CSC4CCCCC4)c4cccc(O)c4C(=O)C3C(=O)[C@]2(O)C(=O)C(C(N)=O)C1=O
BDBM50046503 CCSC[C@@H]1C2[C@H](O)C3[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C2C(=O)c2c(O)cccc12
BDBM50046504 CC(C)SC[C@@H]1C2[C@H](O)C3[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C2C(=O)c2c(O)cccc12
BDBM50046505 CN(C)[C@H]1C2[C@@H](O)C3[C@@H](CSCC(O)CO)c4cccc(O)c4C(=O)C3C(=O)[C@]2(O)C(=O)C(C(N)=O)C1=O
BDBM50046506 CN(C)[C@H]1C2[C@@H](O)C3[C@@H](CSCc4ccc(Cl)c(Cl)c4)c4cccc(O)c4C(=O)C3C(=O)[C@]2(O)C(=O)C(C(N)=O)C1=O
BDBM50046507 COc1ccc(SC[C@@H]2C3[C@H](O)C4[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]4(O)C(=O)C3C(=O)c3c(O)cccc23)cc1
BDBM50046508 CCCCCCSC[C@@H]1C2[C@H](O)C3[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C2C(=O)c2c(O)cccc12
BDBM50046509 CC(C)CCSC[C@@H]1C2[C@H](O)C3[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C2C(=O)c2c(O)cccc12
BDBM50046510 CC(C)CSC[C@@H]1C2[C@H](O)C3[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C2C(=O)c2c(O)cccc12
BDBM50046511 CSC[C@@H]1C2[C@H](O)C3[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C2C(=O)c2c(O)cccc12
BDBM50046512 CN(C)[C@H]1C2[C@@H](O)C3[C@@H](CSC4CCCC4)c4cccc(O)c4C(=O)C3C(=O)[C@]2(O)C(=O)C(C(N)=O)C1=O
BDBM50046513 CCCCCCCCCCSC[C@@H]1C2[C@H](O)C3[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C2C(=O)c2c(O)cccc12
BDBM50046514 CN(C)[C@H]1C2[C@@H](O)C3[C@@H](CSC(C)(C)C)c4cccc(O)c4C(=O)C3C(=O)[C@]2(O)C(=O)C(C(N)=O)C1=O
BDBM50046516 CN(C)[C@H]1C2[C@@H](O)C3[C@@H](CSCCC(O)=O)c4cccc(O)c4C(=O)C3C(=O)[C@]2(O)C(=O)C(C(N)=O)C1=O
BDBM50046517 CCCSC[C@@H]1C2[C@H](O)C3[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C2C(=O)c2c(O)cccc12
BDBM50046518 CN(C)[C@H]1C2[C@@H](O)C3[C@@H](CSCCO)c4cccc(O)c4C(=O)C3C(=O)[C@]2(O)C(=O)C(C(N)=O)C1=O
BDBM50046519 CN(C)[C@H]1C2[C@@H](O)C3[C@@H](CS(=O)(=O)Cc4ccccc4)c4cccc(O)c4C(=O)C3C(=O)[C@]2(O)C(=O)C(C(N)=O)C1=O
BDBM50046520 CN(C)[C@H]1C2[C@@H](O)C3[C@@H](CSc4ccc(Cl)cc4)c4cccc(O)c4C(=O)C3C(=O)[C@]2(O)C(=O)C(C(N)=O)C1=O
BDBM50368781 CN(C)[C@H]1[C@@H]2C[C@H]3C(C(=O)c4c(O)cccc4[C@@]3(C)O)C(=O)[C@]2(O)C(=O)C(C(N)=O)C1=O |r|
BDBM50422012 CN(C)[C@H]1[C@@H]2C[C@@H]3Cc4c(ccc(O)c4C(=O)C3C(=O)[C@]2(O)C(=O)C(C(N)=O)C1=O)N(C)C