BindingDB logo
myBDB logout

8 SMILES Strings for Multifunctional protein ADE2

Compound NameSMILES String
BDBM50247807 Nc1c(ncn1[C@@H]1O[C@H](COP([O-])([O-])=O)[C@@H](O)[C@H]1O)[N+]([O-])=O |r|
BDBM50247808 O[C@H]1[C@@H](O)[C@@H](O[C@@H]1COP([O-])([O-])=O)n1cnc(c1)[N+]([O-])=O |r|
BDBM50247809 Nc1c(C=O)ncn1[C@@H]1O[C@H](COP([O-])([O-])=O)[C@@H](O)[C@H]1O |r|
BDBM50247810 O[C@H]1[C@@H](O)[C@@H](O[C@@H]1COP([O-])([O-])=O)n1ccc(c1)[N+]([O-])=O |r|
BDBM50247822 O[C@H]1[C@@H](O)[C@@H](O[C@@H]1COP([O-])([O-])=O)n1cc(cn1)[N+]([O-])=O |r|
BDBM50247823 Nc1c(cnn1[C@@H]1O[C@H](COP([O-])([O-])=O)[C@@H](O)[C@H]1O)C([O-])=O |r|
BDBM50247824 Nc1c(cnn1[C@@H]1O[C@H](COP([O-])([O-])=O)[C@@H](O)[C@H]1O)[N+]([O-])=O |r|
BDBM50247825 Nc1c(nnn1[C@@H]1O[C@H](COP([O-])([O-])=O)[C@@H](O)[C@H]1O)C([O-])=O |r|