BindingDB logo
myBDB logout

2 SMILES Strings for MurA (E. cloacae)

Compound NameSMILES String
BDBM119069 CN([C@@H](CCCC(O)=O)C(O)=O)C(=O)C1CC(CCC1NS(=O)(=O)c1cccc2ccccc12)OS(=O)(=O)c1cccc2ccccc12 |r|
BDBM119075 Cc1c(O)c2Oc2c(O)c1O