BindingDB logo
myBDB logout

2 SMILES Strings for MurA (H. influenzae)

Compound NameSMILES String
BDBM34233 O=c1n([se]c2ccccc12)-c1ccccc1
BDBM119074 Oc1ccc(OC2=C(Cl)C(=O)c3ncccc3C2=O)cc1 |c:6|