BindingDB logo
myBDB logout

10 SMILES Strings for MurA (P. aeruginosa)

Compound NameSMILES String
BDBM119070 OC[C@@H](O)C(=C)C(=O)OC1C\C=C\CC\C(CO)=C\[C@H]2OC(=O)C(=C)[C@H]12 |r,t:11,17|
BDBM50024894 C[C@@H]1O[C@@H]1P(O)(O)=O |r|
BDBM50096873 C[C@H]1CCC[C@]2(C)C[C@H]3OC(=O)C(=C)[C@H]3C=C12 |r,t:16|
BDBM50194428 C\C1=C/[C@H]2OC(=O)C(=C)[C@@H]2[C@@H](CC(C)=CCC1)OC(=O)C(\CO)=C\CO |c:1|
BDBM50194429 C\C1=C\CC[C@@]2(C)O[C@H]2[C@H]2OC(=O)C(=C)[C@@H]2CC1 |r,t:1|
BDBM50194430 OCC(=C)C(=O)O[C@H]1CC(=C)[C@@H]2C[C@H](O)C(=C)[C@@H]2[C@H]2OC(=O)C(=C)[C@H]12 |r|
BDBM50194425 CC1=CCC[C@@]2(C)CC[C@H]3[C@@H](OC(=O)C3=C)[C@H]12 |t:1|
BDBM50370831 C=C1CC[C@@H]2[C@H]1[C@H]1OC(=O)C(=C)[C@@H]1CCC2=C |r|
BDBM50370832 CC1=CCC\C(CO)=C\[C@H]2OC(=O)C(=C)[C@@H]2[C@H](C1)OC(=O)C(=C)[C@H](O)CO |r,t:7|
BDBM50411242 C\C1=C/CC\C(C)=C\[C@H]2OC(=O)C(=C)[C@@H]2CC1 |r,c:1,t:6|