BindingDB logo
myBDB logout

4 SMILES Strings for MurA (S. aureus)

Compound NameSMILES String
BDBM119072 CN1CCN(CC1)C1CCc2ccccc2C1=O
BDBM119073 Oc1cc(Cl)c2oc(=O)sc2c1Cl
BDBM119091 CC(C)[C@H](NC(=O)[C@H](NC(=O)[C@H](N)c1ccc(O)cc1)c1cc(O)cc(O)c1)C(=O)N[C@@H](C(=O)N[C@H](C(=O)N[C@@H](C(=O)N[C@H](C(=O)N[C@@H](C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(=O)N[C@H](C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(O)=O)C(O)=O)c1ccc(O)cc1)c1cc(O)cc(O)c1)c1cc(O)cc(O)c1)c1ccc(O)cc1)c1cc(O)cc(O)c1)c1ccc(O)cc1)c1cc(O)cc(O)c1 |r|
BDBM50428795 [O-][N+](=O)C(\Br)=C\c1ccc(Br)o1