BindingDB logo
myBDB logout

48 SMILES Strings for MurB (S. aureus)

Compound NameSMILES String
BDBM11304 FC(F)(F)c1nnc(SC(=O)c2ccc(o2)C#Cc2ccccc2)[nH]1
BDBM119078 CCOC(=O)C(=NNc1cccc(c1)C(F)(F)F)C1=Nc2ccccc2SC1 |w:6.6,t:19|
BDBM119079 CC1(CC(=O)Nc2ccc(Cl)cc2Cl)C(=O)N(N(C1=O)c1ccc(Cl)cc1)c1ccc(Cl)cc1
BDBM119080 [O-][N+](=O)c1cnc(NC(=O)Nc2ccc(Cl)c(Cl)c2)s1
BDBM119122 FC(F)(F)c1ccc(cc1)C1C(=O)OC(=Cc2cccc3ccccc23)C1=O |w:15.16|
BDBM50166475 Clc1ccc(cc1)N1N(C(=O)C(CCCCCCc2ccccc2)(CCCCCCc2ccccc2)C1=O)c1ccc(Cl)cc1
BDBM50166476 Oc1c(Cc2ccccc2Cl)c(=O)n(-c2ccc(Cl)cc2)n1-c1ccc(Cl)cc1
BDBM50166478 Oc1c(CCCCCCc2ccccc2)c(=O)n(-c2ccc(Cl)cc2)n1-c1ccc(Cl)cc1
BDBM50166479 CCN(CCc1c(O)n(-c2ccc(Cl)cc2)n(-c2ccc(Cl)cc2)c1=O)Cc1ccccc1
BDBM50166480 Oc1c(CC(=O)c2ccc(F)cc2)c(=O)n(-c2ccc(Cl)cc2)n1-c1ccc(Cl)cc1
BDBM50166483 Oc1c(CCOCc2ccccc2)c(=O)n(-c2ccc(Cl)cc2)n1-c1ccc(Cl)cc1
BDBM50166484 CC1(CCCCCCc2ccccc2)C(=O)N(N(C1=O)c1ccc(Cl)cc1)c1ccc(Cl)cc1
BDBM50166485 Fc1ccc(C(=O)CC2(CC(=O)c3ccc(F)cc3F)C(=O)N(N(C2=O)c2ccc(Cl)cc2)c2ccc(Cl)cc2)c(F)c1
BDBM50166486 Oc1c(Cc2ccc(Cl)cc2Cl)c(=O)n(-c2ccc(Cl)cc2)n1-c1ccc(Cl)cc1
BDBM50166491 CC1(CC(=O)c2ccc(F)cc2F)C(=O)N(N(C1=O)c1ccc(Cl)cc1)c1ccc(Cl)cc1
BDBM50166493 Oc1c(CCSCc2ccccc2)c(=O)n(-c2ccc(Cl)cc2)n1-c1ccc(Cl)cc1
BDBM50166494 Oc1c(CCC(=O)c2ccc(F)cc2)c(=O)n(-c2ccc(Cl)cc2)n1-c1ccc(Cl)cc1
BDBM50166495 Oc1c(CCCCCc2ccccc2)c(=O)n(-c2ccc(Cl)cc2)n1-c1ccc(Cl)cc1
BDBM50166496 Oc1c(Cc2ccc(cc2)C2(CC=CC=C2)C#N)c(=O)n(-c2ccc(Cl)cc2)n1-c1ccc(Cl)cc1 |c:13,15|
BDBM50166497 Oc1c(CCCC(=O)c2ccc(F)cc2)c(=O)n(-c2ccc(Cl)cc2)n1-c1ccc(Cl)cc1
BDBM50166499 Clc1ccc(cc1)N1N(C(=O)C(CCOCc2ccccc2)(CCOCc2ccccc2)C1=O)c1ccc(Cl)cc1
BDBM50166500 Oc1c(CCCCc2ccccc2)c(=O)n(-c2ccc(Cl)cc2)n1-c1ccc(Cl)cc1
BDBM50166502 CC1C(OCC(=O)c2ccc(F)cc2F)N(N(C1=O)c1ccc(Cl)cc1)c1ccc(Cl)cc1
BDBM50221041 Oc1c2COCc2nn1-c1ccc(Cl)cc1
BDBM50221022 Oc1c2SCCc2nn1-c1cccc(Cl)c1
BDBM50221029 Oc1c2SCCc2nn1-c1ccccc1
BDBM50221037 Oc1c2SCCc2nn1-c1ccc(Br)cc1
BDBM50221038 Oc1c2SCCc2nn1-c1ccc(Cl)c(Cl)c1
BDBM50221018 Oc1c2SCCc2nn1-c1ccc(Cl)cc1
BDBM50221019 CC1Cc2nn(c(O)c2S1)-c1ccc(Cl)cc1
BDBM50221020 Oc1c2SCCc2nn1-c1ccc(cc1)C(F)(F)F
BDBM50221021 Oc1c2CCCCc2nn1-c1ccc(Cl)c(Cl)c1
BDBM50221023 Oc1c2SCCc2nn1-c1ccc(cc1)C#N
BDBM50221024 CC(C)(C)c1ccc(cc1)-n1nc2CCSc2c1O
BDBM50221025 Oc1c2SC(Cc2nn1-c1ccc(Cl)cc1)c1ccccc1
BDBM50221026 Oc1c2SCCc2nn1-c1cc(cc(c1)C(F)(F)F)C(F)(F)F
BDBM50221027 Oc1c2SCCc2nn1-c1cccc(c1)C#N
BDBM50221028 Oc1c2SCCc2nn1-c1ccccc1C(F)(F)F
BDBM50221030 Oc1c2SCCc2nn1-c1ccc(cc1)[N+]([O-])=O
BDBM50221031 CC(C)c1ccc(cc1)-n1nc2CCSc2c1O
BDBM50221032 Oc1c2SCCc2nn1-c1cccc(c1)[N+]([O-])=O
BDBM50221033 NC(=O)c1cccc(c1)-n1nc2CCSc2c1O
BDBM50221034 Oc1c2[S+]([O-])CCc2nn1-c1ccc(Cl)c(Cl)c1
BDBM50221035 Oc1c2SCCc2nn1-c1ccc(F)cc1
BDBM50221036 Oc1c2SCCc2nn1-c1cccc(c1)C(F)(F)F
BDBM50221039 Oc1c2CSCCc2nn1-c1ccc(cc1)[N+]([O-])=O
BDBM50221040 Oc1c2CSCc2nn1-c1ccc(Cl)c(Cl)c1
BDBM50221042 Oc1c2CSCc2nn1-c1ccc(Cl)cc1