BindingDB logo
myBDB logout

20 SMILES Strings for MurC (S. aureus)

Compound NameSMILES String
BDBM119122 FC(F)(F)c1ccc(cc1)C1C(=O)OC(=Cc2cccc3ccccc23)C1=O |w:15.16|
BDBM50221022 Oc1c2SCCc2nn1-c1cccc(Cl)c1
BDBM50221029 Oc1c2SCCc2nn1-c1ccccc1
BDBM50221037 Oc1c2SCCc2nn1-c1ccc(Br)cc1
BDBM50221038 Oc1c2SCCc2nn1-c1ccc(Cl)c(Cl)c1
BDBM50221018 Oc1c2SCCc2nn1-c1ccc(Cl)cc1
BDBM50221019 CC1Cc2nn(c(O)c2S1)-c1ccc(Cl)cc1
BDBM50221020 Oc1c2SCCc2nn1-c1ccc(cc1)C(F)(F)F
BDBM50221023 Oc1c2SCCc2nn1-c1ccc(cc1)C#N
BDBM50221024 CC(C)(C)c1ccc(cc1)-n1nc2CCSc2c1O
BDBM50221025 Oc1c2SC(Cc2nn1-c1ccc(Cl)cc1)c1ccccc1
BDBM50221026 Oc1c2SCCc2nn1-c1cc(cc(c1)C(F)(F)F)C(F)(F)F
BDBM50221027 Oc1c2SCCc2nn1-c1cccc(c1)C#N
BDBM50221028 Oc1c2SCCc2nn1-c1ccccc1C(F)(F)F
BDBM50221030 Oc1c2SCCc2nn1-c1ccc(cc1)[N+]([O-])=O
BDBM50221031 CC(C)c1ccc(cc1)-n1nc2CCSc2c1O
BDBM50221032 Oc1c2SCCc2nn1-c1cccc(c1)[N+]([O-])=O
BDBM50221033 NC(=O)c1cccc(c1)-n1nc2CCSc2c1O
BDBM50221035 Oc1c2SCCc2nn1-c1ccc(F)cc1
BDBM50221036 Oc1c2SCCc2nn1-c1cccc(c1)C(F)(F)F