BindingDB logo
myBDB logout

11 SMILES Strings for MurE

Compound NameSMILES String
BDBM85276 OP(O)(=O)OC(CNS(=O)(=O)c1ccc(cc1)C(F)(F)F)CN1CCOCC1
BDBM85277 OP(O)(=O)OC(CNS(=O)(=O)c1cccc(c1)C(F)(F)F)CN1CCOCC1
BDBM85278 Cc1ccc(cc1)S(=O)(=O)NCC(CN1CCOCC1)OP(O)(O)=O
BDBM85279 CCc1ccc(cc1)S(=O)(=O)NCC(CN1CCOCC1)OP(O)(O)=O
BDBM119123 Oc1ccc(C=C2SC(S)=NC2=O)c(O)c1O |w:5.4,c:9|
BDBM119107 OC(=O)CC[C@@H](NC(=O)c1cccc(NCc2ccc(C=C3SC(S)=NC3=O)cc2)c1)C(O)=O |r,w:20.19,c:24|
BDBM119108 C[C@H](NC(=O)CCCCCOP([O-])(=O)OP([O-])(=O)OCC1OC(C(O)C1O)n1ccc(=O)[nH]c1=O)C(=O)NC(CCP([O-])(=O)CC(CCCC([NH3+])C([O-])=O)C([O-])=O)C([O-])=O |r|
BDBM119109 C[C@@H](CS(=O)(=O)N[C@H](CCC(O)=O)C(O)=O)NS(=O)(=O)c1ccc(cc1)-c1ccccc1 |r|
BDBM119122 FC(F)(F)c1ccc(cc1)C1C(=O)OC(=Cc2cccc3ccccc23)C1=O |w:15.16|
BDBM50248217 COc1ccc(cc1)S(=O)(=O)NCC(CN1CCOCC1)OP(O)(O)=O
BDBM50248218 OP(O)(=O)OC(CNS(=O)(=O)c1ccc(F)cc1)CN1CCOCC1