BindingDB logo
myBDB logout

3 SMILES Strings for MurE (E. coli)

Compound NameSMILES String
BDBM119094 OC(=O)c1cc(cc(c1)-c1ccc(CC2SC(=S)N(C2=O)c2ccc3OCOc3c2)o1)C(O)=O
BDBM119107 OC(=O)CC[C@@H](NC(=O)c1cccc(NCc2ccc(C=C3SC(S)=NC3=O)cc2)c1)C(O)=O |r,w:20.19,c:24|
BDBM119122 FC(F)(F)c1ccc(cc1)C1C(=O)OC(=Cc2cccc3ccccc23)C1=O |w:15.16|