BindingDB logo
myBDB logout

2 SMILES Strings for MurE (M. tuberculosis)

Compound NameSMILES String
BDBM119110 C[C@@]12Cc3cc4OCOc4cc3-c3cccc(CCN1)c23 |r|
BDBM119111 [#6]-[#6](-[#6])-[#6](=O)-c1c(-[#8])cc(-[#8])cc1-[#8]-[#6]\[#6]=[#6](\[#6])-[#6]-[#6]\[#6]=[#6](\[#6])-[#6]