BindingDB logo
myBDB logout

23 SMILES Strings for MurF

Compound NameSMILES String
BDBM85276 OP(O)(=O)OC(CNS(=O)(=O)c1ccc(cc1)C(F)(F)F)CN1CCOCC1
BDBM85277 OP(O)(=O)OC(CNS(=O)(=O)c1cccc(c1)C(F)(F)F)CN1CCOCC1
BDBM85278 Cc1ccc(cc1)S(=O)(=O)NCC(CN1CCOCC1)OP(O)(O)=O
BDBM85279 CCc1ccc(cc1)S(=O)(=O)NCC(CN1CCOCC1)OP(O)(O)=O
BDBM119123 Oc1ccc(C=C2SC(S)=NC2=O)c(O)c1O |w:5.4,c:9|
BDBM119112 CCN(CC)S(=O)(=O)c1ccc(Cl)c(c1)C(=O)NC1=C(C#N)C2CCCC2S1 |c:19|
BDBM119113 Clc1cc(Cl)c(cc1C(=O)NC1=C(C#N)C2CCCC2S1)S(=O)(=O)N1CCOCC1 |c:12|
BDBM119114 Oc1ccc(cc1)[C@@H]1CCC2C(C1)SC(NC(=O)c1cc(c(Cl)cc1Cl)S(=O)(=O)N1CCOCC1)=C2C#N |r,c:38|
BDBM119115 Oc1cccc(CN2CCC3C(C2)SC(NC(=O)c2cc(c(Cl)cc2Cl)S(=O)(=O)N2CCOCC2)=C3C#N)c1 |c:37|
BDBM119116 [#7]\[#6](-[#7])=[#7+]\[#6]-[#6]-[#8]-c1ccc(Cl)c(c1)-[#6](=O)-[#7]-[#6]-1=[#6](C#N)-[#6]-2-[#6]-[#6]-[#7](-[#6]-c3ccc(-[#8])cc3)-[#6]-[#6]-2-[#16]-1 |c:18|
BDBM119117 OCCc1ccccc1Nc1nc(Cl)nc(Cl)n1
BDBM119118 Clc1cnn(COc2cccc(c2)C(=O)NC2=C(C#C)C3CCCC3S2)c1 |c:17|
BDBM119119 NC(=N)c1ccc(NC(=O)c2cnc(Nc3nc(cs3)-c3cccc(c3)C(F)(F)F)nc2C(F)(F)F)cc1
BDBM119120 COc1ccc(cc1OC)C(NC(=O)c1ccccc1)c1ccc2cccnc2c1O
BDBM119121 COc1ccc2nc(OC)c(cc2c1)[C@@H](c1ccccc1)[C@@](O)(CCN(C)C)CCc1ccccc1 |r|
BDBM50248217 COc1ccc(cc1)S(=O)(=O)NCC(CN1CCOCC1)OP(O)(O)=O
BDBM50248218 OP(O)(=O)OC(CNS(=O)(=O)c1ccc(F)cc1)CN1CCOCC1
BDBM50046814 Cc1cc(\C=C2\S\C(NC2=O)=N\c2ccc(C)cc2)c(C)n1-c1cc(cc(c1)C(O)=O)C(O)=O
BDBM50046815 Cc1cc(\C=C2\S\C(NC2=O)=N\c2ccccc2)c(C)n1-c1cc(cc(c1)C(O)=O)C(O)=O
BDBM50046817 COc1ccc(cc1)\N=C1/NC(=O)\C(S1)=C/c1cc(C)n(c1C)-c1cc(cc(c1)C(O)=O)C(O)=O
BDBM50046818 Cc1cc(\C=C2\S\C(NC2=O)=N\c2ccc(Cl)cc2)c(C)n1-c1cc(cc(c1)C(O)=O)C(O)=O
BDBM50046823 Cc1cc(\C=C2\C(=O)NC(=S)N(C2=O)c2ccccc2F)c(C)n1-c1cc(cc(c1)C(O)=O)C(O)=O
BDBM50046819 Cc1cc(\C=C2\S\C(NC2=O)=N\c2ccc(Br)cc2)c(C)n1-c1cc(cc(c1)C(O)=O)C(O)=O