BindingDB logo
myBDB logout

1 SMILES String for MurF (S. aureus)

Compound NameSMILES String
BDBM119115 Oc1cccc(CN2CCC3C(C2)SC(NC(=O)c2cc(c(Cl)cc2Cl)S(=O)(=O)N2CCOCC2)=C3C#N)c1 |c:37|