BindingDB logo
myBDB logout

49 SMILES Strings for MurF (S. pneumoniae)

Compound NameSMILES String
BDBM81625 OCCCCNS(=O)(=O)c1ccc(Cl)c(c1)C(=O)Nc1sc2CCCc2c1C#N
BDBM81627 NS(=O)(=O)c1ccc(Cl)c(c1)C(=O)Nc1sc2CCCc2c1C#N
BDBM81628 CCN(CC)S(=O)(=O)c1ccc(Cl)c(c1)C(=O)Nc1sccc1C#N
BDBM81629 CCN(CC)S(=O)(=O)c1ccc(Cl)c(c1)C(=O)Nc1sc(Br)cc1C#N
BDBM119115 Oc1cccc(CN2CCC3C(C2)SC(NC(=O)c2cc(c(Cl)cc2Cl)S(=O)(=O)N2CCOCC2)=C3C#N)c1 |c:37|
BDBM119116 [#7]\[#6](-[#7])=[#7+]\[#6]-[#6]-[#8]-c1ccc(Cl)c(c1)-[#6](=O)-[#7]-[#6]-1=[#6](C#N)-[#6]-2-[#6]-[#6]-[#7](-[#6]-c3ccc(-[#8])cc3)-[#6]-[#6]-2-[#16]-1 |c:18|
BDBM119118 Clc1cnn(COc2cccc(c2)C(=O)NC2=C(C#C)C3CCCC3S2)c1 |c:17|
BDBM50137752 Clc1ccc(cc1C(=O)Nc1sc2CCCCc2c1C#N)S(=O)(=O)N1CCOCC1
BDBM50137753 CN(C)CCCNS(=O)(=O)c1ccc(Cl)c(c1)C(=O)Nc1sc2CCCc2c1C#N
BDBM50137754 CCN(CC)S(=O)(=O)c1ccc(Cl)c(c1)C(=O)N(C)c1sc2CCCc2c1C#N
BDBM50137755 OCCCNc1cc(Cl)c(cc1S(=O)(=O)N1CCOCC1)C(=O)Nc1sc2CCCc2c1C#N
BDBM50137756 Brc1ccc(cc1C(=O)Nc1sc2CCCc2c1C#N)S(=O)(=O)N1CCOCC1
BDBM50137757 Clc1ccc(cc1C(=O)Nc1sc2CCCc2c1C#N)S(=O)(=O)N1CCOCC1
BDBM50137758 Oc1ccc(cc1)C1CCc2c(C1)sc(NC(=O)c1cc(c(Cl)cc1Cl)S(=O)(=O)N1CCOCC1)c2C#N
BDBM50137759 CCN(CC)S(=O)(=O)c1ccc(Cl)c(c1)C(=O)Nc1sc2CCCCc2c1C#N
BDBM50137760 Clc1cc(Cl)c(cc1C(=O)Nc1sc2CCCc2c1C#N)S(=O)(=O)N1CCOCC1
BDBM50137761 CCN(CC)S(=O)(=O)c1ccc(Cl)c(c1)C(=O)Nc1sc2CCCCCc2c1C#N
BDBM50137762 CCN(CC)S(=O)(=O)c1ccc(Cl)c(c1)C(=O)Nc1sc2CC(CCc2c1C#N)c1ccc(O)cc1
BDBM50137763 O=C(Nc1sc2CCCc2c1C#N)c1cccc(c1)S(=O)(=O)N1CCOCC1
BDBM50137764 CN(C)CCCNc1ccc(cc1C(=O)Nc1sc2CCCc2c1C#N)S(=O)(=O)N1CCOCC1
BDBM50137765 CCOC(=O)c1c(NC(=O)c2cc(ccc2Cl)S(=O)(=O)N(CC)CC)sc2CCCc12
BDBM50137766 CNS(=O)(=O)c1ccc(Cl)c(c1)C(=O)Nc1sc2CCCc2c1C#N
BDBM50137767 CNc1cc(Cl)c(cc1S(=O)(=O)N1CCOCC1)C(=O)Nc1sc2CCCc2c1C#N
BDBM50137768 Clc1cc(Cl)c(cc1C(=O)Nc1sc2CC(CCc2c1C#N)c1ccccc1)S(=O)(=O)N1CCOCC1
BDBM50137769 CCOC(=O)C1CCc2c(C1)sc(NC(=O)c1cc(ccc1Cl)S(=O)(=O)N(CC)CC)c2C#N
BDBM50137770 Clc1ccc(cc1C(=O)Nc1sc2CCCc2c1C#N)S(=O)(=O)Nc1ccccc1
BDBM50137771 CCN(CC)S(=O)(=O)c1ccc(Cl)c(c1)C(=O)Nc1sc2CCCc2c1CNC(C)=O
BDBM50137772 CCOc1ccc(cc1C(=O)Nc1sc2CCCc2c1C#N)S(=O)(=O)N1CCOCC1
BDBM50137773 CCN(CC)S(=O)(=O)c1ccc(Cl)c(c1)C(C)Nc1sc2CCCc2c1C#N
BDBM50137774 CCN(CC)S(=O)(=O)c1ccc(Cl)c(c1)C(=O)Nc1sc2CCCc2c1CN
BDBM50137775 Clc1cc(Cl)c(cc1C(=O)Nc1sc2CCCCc2c1C#N)S(=O)(=O)N1CCOCC1
BDBM50137776 CN(C)c1ccc(cc1C(=O)Nc1sc2CCCc2c1C#N)S(=O)(=O)N1CCOCC1
BDBM50137777 CC(COc1ccc(cc1C(=O)Nc1sc2CCCc2c1C#N)S(=O)(=O)N1CCOCC1)c1ccccc1
BDBM50137778 CCN(CC)S(=O)(=O)c1ccc(Cl)c(c1)C(=O)Nc1sc2CCCc2c1C#N
BDBM50137779 Fc1cc(Cl)c(cc1S(=O)(=O)N1CCOCC1)C(=O)Nc1sc2CCCc2c1C#N
BDBM50137780 CCN(CC)S(=O)(=O)c1cc(C(=O)Nc2sc3CCCc3c2C#N)c(Cl)cc1Cl
BDBM50137781 OCCCNS(=O)(=O)c1ccc(Cl)c(c1)C(=O)Nc1sc2CCCc2c1C#N
BDBM50137782 CCN(CC)S(=O)(=O)c1ccc(Cl)c(c1)C(=O)Nc1sc2CCCc2c1C(N)=O
BDBM50137783 Clc1ccc(cc1C(=O)Nc1sc2CCCCCc2c1C#N)S(=O)(=O)N1CCOCC1
BDBM50137784 CCN(CC)S(=O)(=O)c1ccc(Cl)c(CNc2sc3CCCc3c2C#N)c1
BDBM50137785 CN(C)CCCNc1cc(Cl)c(cc1S(=O)(=O)N1CCOCC1)C(=O)Nc1sc2CCCc2c1C#N
BDBM50137786 CCN(CC)S(=O)(=O)c1cc(C(=O)Nc2sc3CC(CCc3c2C#N)c2ccc(O)cc2)c(Cl)cc1Cl
BDBM50371258 CCN(CC)S(=O)(=O)c1cc(C(=O)Nc2sc3CCC(Cc3c2C#N)c2ccc(O)cc2)c(Cl)cc1Cl |w:19.26|
BDBM50371259 Oc1ccc(cc1)C1CCc2sc(NC(=O)c3cc(c(Cl)cc3Cl)S(=O)(=O)N3CCOCC3)c(C#N)c2C1 |w:7.7|
BDBM50371260 CCOC(=O)C1CCc2sc(NC(=O)c3cc(ccc3Cl)S(=O)(=O)N(CC)CC)c(C#N)c2C1 |w:5.4|
BDBM50371261 CCN(CC)S(=O)(=O)c1ccc(Cl)c(c1)C(=O)Nc1sc2CCC(Cc2c1C#N)c1ccc(O)cc1 |w:23.31|
BDBM50371262 Clc1cc(Cl)c(cc1C(=O)Nc1sc2CCC(Cc2c1C#N)c1ccccc1)S(=O)(=O)N1CCOCC1 |w:16.24|
BDBM50371263 Clc1ccc(cc1C(=O)Nc1sc(CCc2ccncc2)cc1C#N)S(=O)(=O)N1CCOCC1
BDBM50371264 Clc1ccc(cc1C(=O)Nc1sc2CCCc2c1C#N)S(=O)(=O)N1CCCCC1