BindingDB logo
myBDB logout

3 SMILES Strings for Muscarinic acetylcholine receptor M2 and M4

Compound NameSMILES String
BDBM50005363 Cc1noc(n1)C1CN2CCC1C2 |TLB:4:6:12:10.9|
BDBM50006243 C[C@@H]1O[C@H](C[N+](C)(C)C)C[C@H]1O
BDBM50229871 [I-].C[C@@H]1O[C@H](C[N+](C)(C)C)C[C@H]1F