BindingDB logo
myBDB logout

7 SMILES Strings for Muscle-type nicotinic acetylcholine receptor

Compound NameSMILES String
BDBM50094298 CCCC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)NCCCNCCCCNCCCN
BDBM50094299 CCCC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)NCCCCCCCCCCCCN
BDBM50111636 CCCC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)NCCCCCCCCN
BDBM50111637 CCCC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)NCCCCCCCCCN
BDBM50111638 CCCC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)NCCCCCCCCCCCN
BDBM50111639 CCCC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)NCCCCCCCN
BDBM50111640 CCCC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)NCCCCCCCCCCN