BindingDB logo
myBDB logout

4 SMILES Strings for Myc proto-oncogene protein

Compound NameSMILES String
BDBM23926 Oc1ccc(\C=C\c2cc(O)cc(O)c2)cc1
BDBM93880 OC(=O)c1ccc(Nc2ccc([N+]([O-])=O)c3nonc23)cc1
BDBM50431277 COc1cc(OC)cc(\C=C/c2ccc(OC)c(OC)c2)c1
BDBM50423921 [O-][N+](=O)c1ccc(Nc2ccccc2-c2ccccc2)c2nonc12