BindingDB logo
myBDB logout

15 SMILES Strings for Myeloperoxidase

Compound NameSMILES String
BDBM312157 CC[C@@H](N)c1cc(Cl)ccc1Cn1c2cc[nH]c2c(=O)[nH]c1=S |r,$;;;;;;;;;;;;;;;;HN;;;;;;$|
BDBM312171 CC(N)c1cc(Cl)ccc1Cn1c2cc[nH]c2c(=O)[nH]c1=S |$;;;;;;;;;;;;;;;HN;;;;;;$|
BDBM312172 C[C@@H](N)c1cc(Cl)ccc1Cn1c2cc[nH]c2c(=O)[nH]c1=S |r,$;;;;;;;;;;;;;;;HN;;;;;;$|
BDBM312173 C[C@H](N)c1cc(Cl)ccc1Cn1c2cc[nH]c2c(=O)[nH]c1=S |r,$;;;;;;;;;;;;;;;HN;;;;;;$|
BDBM312243 CCNCc1cc(Cl)ccc1Cn1c2cc[nH]c2c(=O)[nH]c1=S |$;;HN;;;;;;;;;;;;;;HN;;;;;;$|
BDBM312244 NCc1cc(Cl)ccc1Cn1c2cc[nH]c2c(=O)[nH]c1=S |$;;;;;;;;;;;;;;HN;;;;;;$|
BDBM312176 CNC(C)c1cc(Cl)ccc1Cn1c2cc[nH]c2c(=O)[nH]c1=S |$;HN;;;;;;;;;;;;;;;HN;;;;;;$|
BDBM312245 CNCc1cc(Cl)ccc1Cn1c2cc[nH]c2c(=O)[nH]c1=S |$;HN;;;;;;;;;;;;;;HN;;;;;;$|
BDBM312251 O=c1[nH]c(=S)n(Cc2ccccc2CNCC2CCC2)c2cc[nH]c12 |$;;;;;;;;;;;;;;HN;;;;;;;;;HN;$|
BDBM312256 O=c1[nH]c(=S)n(Cc2ccccc2CNC2CCC2)c2cc[nH]c12 |$;;;;;;;;;;;;;;HN;;;;;;;;HN;$|
BDBM312257 O=c1[nH]c(=S)n(Cc2ccccc2CNC2CCCC2)c2cc[nH]c12 |$;;;;;;;;;;;;;;HN;;;;;;;;;HN;$|
BDBM312258 CC(C)CNCc1ccccc1Cn1c2cc[nH]c2c(=O)[nH]c1=S |$;;;;HN;;;;;;;;;;;;;HN;;;;;;$|
BDBM312261 CC(C)NCc1ccccc1Cn1c2cc[nH]c2c(=O)[nH]c1=S |$;;;HN;;;;;;;;;;;;;HN;;;;;;$|
BDBM312264 NCc1cc(ccc1Cn1c2cc[nH]c2c(=O)[nH]c1=S)C(F)(F)F |$;;;;;;;;;;;;;HN;;;;;;;;;;$|
BDBM312265 CNCc1cc(ccc1Cn1c2cc[nH]c2c(=O)[nH]c1=S)C(F)(F)F |$;HN;;;;;;;;;;;;;HN;;;;;;;;;;$|