BindingDB logo
myBDB logout

1 SMILES String for Myosin-Va

Compound NameSMILES String
BDBM50345502 Oc1c(Br)cc(Br)cc1-c1[nH]c(Br)c(Br)c1Br