BindingDB logo
myBDB logout

27 SMILES Strings for N-acetyltransferase Eis

Compound NameSMILES String
BDBM50201746 COC(=O)c1cc2occc2n1CC(=O)c1cccc(Cl)c1
BDBM50201747 COC(=O)c1cc2occc2n1CC(=O)c1ccc(F)cc1
BDBM50201759 Brc1cccc(c1)C(=O)CN1C(=O)C2(OCCO2)c2ccccc12
BDBM50201760 COC(=O)c1cc2occc2n1CC(=O)c1cccc(Br)c1
BDBM50201739 COC(=O)c1cc2occc2n1CC(=O)c1ccc(C)cc1
BDBM50201740 COc1cccc(c1)C(=O)CN1C(=O)C2(OCCO2)c2ccccc12
BDBM50201741 [O-][N+](=O)c1cccc(c1)C(=O)CN1C(=O)C2(OCCO2)c2ccccc12
BDBM50201742 COC(=O)c1cc2occc2n1CC(=O)c1cccc(F)c1
BDBM50201743 COC(=O)c1cc2occc2n1CC(=O)c1ccc2ccccc2c1
BDBM50201744 COC(=O)c1cc2occc2n1CC(=O)c1cccc(OC)c1
BDBM50201745 COC(=O)c1cc2occc2n1CC(=O)c1ccccc1F
BDBM50201748 COC(=O)c1cc2occc2n1CC(=O)c1ccc(Br)cc1
BDBM50201749 O=C(CN1C(=O)C2(OCCO2)c2ccccc12)c1ccccc1
BDBM50201750 Fc1cccc(c1)C(=O)CN1C(=O)C2(OCCO2)c2ccccc12
BDBM50201751 Brc1ccc(cc1)C(=O)CN1C(=O)C2(OCCO2)c2ccccc12
BDBM50201752 Cc1ccc(cc1)C(=O)CN1C(=O)C2(OCCO2)c2ccccc12
BDBM50201753 CCC(=O)CN1C(=O)C2(OCCO2)c2ccccc12
BDBM50201754 COC(=O)c1cc2occc2n1CC(=O)C(C)(C)C
BDBM50201755 Fc1ccc(cc1)C(=O)CN1C(=O)C2(OCCO2)c2ccccc12
BDBM50201756 COC(=O)c1cc2occc2n1CC(=O)c1ccc(Cl)cc1
BDBM50201757 COC(=O)c1cc2occc2n1CC(=O)c1ccccc1
BDBM50201758 O=C(CN1C(=O)C2(OCCO2)c2ccccc12)c1ccc2ccccc2c1
BDBM50201761 CCC(=O)Cn1c(cc2occc12)C(=O)OC
BDBM50201762 Fc1ccccc1C(=O)CN1C(=O)C2(OCCO2)c2ccccc12
BDBM50201763 Clc1ccc(cc1)C(=O)CN1C(=O)C2(OCCO2)c2ccccc12
BDBM50201764 CC(C)(C)C(=O)CN1C(=O)C2(OCCO2)c2ccccc12
BDBM50201765 Clc1cccc(c1)C(=O)CN1C(=O)C2(OCCO2)c2ccccc12