BindingDB logo
myBDB logout

41 SMILES Strings for N-acylethanolamine acid amidase (NAAA)

Compound NameSMILES String
BDBM50151039 O=C(N[C@H]1CNC1=O)OCc1ccc(cc1)-c1cocn1 |r|
BDBM50151153 CC(C)(C)c1ccc(COC(=O)N[C@H]2CNC2=O)cc1 |r|
BDBM50171286 CCCCCCCCCCCCCCCNC(=O)CCO
BDBM50171291 CCCCCCCCCCCCCCCC(=O)OC1CCCCC1
BDBM50171294 CCCCCCCCCCCCCCCCOC(=O)CC
BDBM50171299 CCCCCCCCCCCCCCCNC(=O)C1CCCCC1
BDBM50309176 CCCCCCCCCCCCCCCNC(=O)c1ccccc1
BDBM50309177 CCCCCCCCCCCCCCCC(=O)OC1CCCC1
BDBM50389607 C[C@@H]1OC(=O)[C@@H]1NC(=O)CCCCCCc1ccccc1 |r|
BDBM50389023 C[C@@H]1OC(=O)[C@@H]1NC(=O)OCCCCCc1ccccc1 |r|
BDBM50439649 CCCCCCC[C@H](C)OC(=O)N[C@@H]1[C@H](C)OC1=O |r|
BDBM50439664 C[C@@H]1OC(=O)[C@@H]1NC(=O)OCc1ccc(cc1)-c1ccccc1 |r|
BDBM50439653 C[C@@H]1OC(=O)[C@@H]1NC(=O)OCCCCCC1CCCCC1 |r|
BDBM50439655 C[C@@H]1OC(=O)[C@@H]1NC(=O)OCCCOCc1ccccc1 |r|
BDBM50063527 OCCNC(=O)CCC\C=C/C[C@@H]1[C@@H](\C=C\[C@H](O)CCc2ccccc2)[C@H](O)CC1=O |r|
BDBM50063528 OCCNC(=O)CCC\C=C/C[C@@H]1[C@@H](\C=C\[C@@H](O)CCc2ccccc2)[C@H](O)CC1=O |r|
BDBM50063529 C[C@H](CO)NC(=O)CCC\C=C/C[C@@H]1[C@@H](\C=C\[C@@H](O)CCc2ccccc2)[C@H](O)CC1=O |r|
BDBM50063530 OCCNC(=O)CCC\C=C/C[C@@H]1[C@@H](\C=C\[C@@H](O)CCc2ccc(I)cc2)[C@H](O)CC1=O |r|
BDBM50063532 OCCCNC(=O)CCC\C=C/C[C@@H]1[C@@H](\C=C\[C@@H](O)CCc2ccccc2)[C@H](O)CC1=O |r|
BDBM50063531 C[C@@H](CO)NC(=O)CCC\C=C/C[C@@H]1[C@@H](\C=C\[C@@H](O)CCc2ccccc2)[C@H](O)CC1=O |r|
BDBM50032463 C[C@@H]1OC(=O)[C@@H]1NC(=O)OCCCCC1CCCCC1 |r|
BDBM233794 CC(C)[C@H]1OC(=O)[C@@H]1NC(=O)OCCCCCc1ccccc1 |r|
BDBM233795 CC(C)[C@H]1OC(=O)[C@@H]1NC(=O)OCc1ccc(cc1)-c1ccccc1 |r|
BDBM233796 CC(C)[C@@H]1OC(=O)[C@@H]1NC(=O)OCCCCCc1ccccc1 |r|
BDBM233797 CC(C)[C@@H]1OC(=O)[C@@H]1NC(=O)OCc1ccc(cc1)-c1ccccc1 |r|
BDBM233798 CC(C)[C@H]1OC(=O)[C@@H]1NC(=O)OC(C)(C)CCCCc1ccccc1 |r|
BDBM233799 CC(C)(C)[C@H]1OC(=O)[C@@H]1NC(=O)OCCCCCc1ccccc1 |r|
BDBM233800 CC(C)(C)[C@H]1OC(=O)[C@@H]1NC(=O)OCc1ccc(cc1)-c1ccccc1 |r|
BDBM233801 CC(C)(C)[C@@H]1OC(=O)[C@@H]1NC(=O)OCCCCCc1ccccc1 |r|
BDBM233790 CC[C@H]1OC(=O)[C@@H]1NC(=O)OCCCCCc1ccccc1 |r|
BDBM233792 CC[C@@H]1OC(=O)[C@@H]1NC(=O)OCCCCCc1ccccc1 |r|
BDBM233791 CC[C@H]1OC(=O)[C@@H]1NC(=O)OCc1ccc(cc1)-c1ccccc1 |r|
BDBM233776 CC(OC(=O)N[C@@H]1[C@H](C)OC1=O)c1ccc(cc1)-c1ccccc1 |r,w:1.0|
BDBM233802 CC(C)(C)[C@@H]1OC(=O)[C@@H]1NC(=O)OCc1ccc(cc1)-c1ccccc1 |r|
BDBM233780 C[C@@H]1OC(=O)[C@@H]1NC(=O)OC12CC3CC(CC(C3)C1)C2 |r,TLB:9:10:13:17.16.15,9:10:17:13.14.15,19:10:17:13.14.15,THB:18:10:13:17.16.15,18:16:13:10.19.11,19:14:17:10.18.11|
BDBM233783 CC(CCCCc1ccccc1)OC(=O)N[C@@H]1[C@H](C)OC1=O |r,w:1.0|
BDBM233793 CC[C@@H]1OC(=O)[C@@H]1NC(=O)OCc1ccc(cc1)-c1ccccc1 |r|
BDBM50151126 CC(OC(=O)N[C@H]1CNC1=O)c1ccc(cc1)C1CCCCC1 |r|
BDBM50151148 O=C(N[C@H]1CNC1=O)OCc1ccc2CCCc2c1 |r|
BDBM50151152 O=C(N[C@H]1CNC1=O)OCc1ccc2CCCCc2c1 |r|
BDBM50151154 CCCCc1ccc(COC(=O)N[C@H]2CNC2=O)cc1 |r|