BindingDB logo
myBDB logout

1 SMILES String for N-lysine methyltransferase SETD6 (SETD6)

Compound NameSMILES String
BDBM225230 CS(=O)(=O)c1ccc(cc1)-c1cnc(NCc2ccco2)n2cnnc12