BindingDB logo
myBDB logout

12 SMILES Strings for N1L

Compound NameSMILES String
BDBM23926 Oc1ccc(\C=C\c2cc(O)cc(O)c2)cc1
BDBM34138 Oc1cc(Cc2ccccc2)c(Cc2ccccc2)cc1O
BDBM50316623 COc1cc(cc(OC)c1OC)\C(=N/c1ccccc1)\C(=N\c1ccccc1)\c1cc(OC)c(OC)c(OC)c1
BDBM50316624 COc1cc(C(c2ccccc2)c2ccccc2)c2ccccc2c1O
BDBM50316625 Oc1cc(C(c2ccccc2)c2ccccc2)c2ccccc2c1O
BDBM50316626 COc1ccc2ccccc2c1-c1c(O)ccc2ccccc12 |(12.2,-23.98,;10.87,-23.22,;9.53,-23.99,;9.54,-25.53,;8.21,-26.31,;6.87,-25.54,;5.54,-26.32,;4.21,-25.56,;4.2,-24.01,;5.53,-23.24,;6.87,-24,;8.2,-23.23,;8.2,-21.7,;9.54,-20.92,;10.87,-21.69,;9.53,-19.37,;8.19,-18.61,;6.86,-19.38,;5.52,-18.62,;4.19,-19.39,;4.19,-20.94,;5.53,-21.71,;6.86,-20.93,)|
BDBM50316627 Oc1ccc(\C=N\c2ccccc2\N=C\c2ccc(O)c(O)c2)cc1O
BDBM50316628 COc1ccc(cc1)C(=N\c1ccc(C)cc1)\c1ccccc1
BDBM50316629 COc1cc(cc(OC)c1OC)-c1ccc2cc(OC)c(OC)c(OC)c2c1
BDBM50316630 COc1cc(ccc1O)C(c1ccc(O)c(OC)c1)c1ccc(O)c(OC)c1
BDBM50316631 COc1ccc(cc1)C(C)c1cc(OC)c(OC)c(OC)c1
BDBM50316632 COc1ccc(CCc2cc(OC)c(O)c(OC)c2)cc1