BindingDB logo
myBDB logout

20 SMILES Strings for NAALADase II

Compound NameSMILES String
BDBM17659 OC(=O)CCC(CP(O)(O)=O)C(O)=O
BDBM50102258 OC(=O)CC[C@H](NC(=O)N[C@@H](CCC(O)=O)C(O)=O)C(O)=O
BDBM50143064 OC(=O)CC[C@H](NC(=O)N[C@@H](C[C@@H](Cc1ccccc1)C(O)=O)C(O)=O)C(O)=O
BDBM50143065 OC(=O)CC[C@H](NC(=O)N[C@@H](CCC(O)=O)c1nnn[nH]1)c1nnn[nH]1
BDBM50143066 C[C@@H](C[C@H](NC(=O)N[C@@H](CCC(O)=O)C(O)=O)C(O)=O)C(O)=O
BDBM50143067 OC(=O)CC[C@H](NC(=O)N[C@@H](CCC(O)=O)c1nnnn1CCC#N)C(O)=O
BDBM50143068 OC(=O)[C@H](CCc1nnn[nH]1)NC(=O)N[C@@H](CCc1nnn[nH]1)C(O)=O
BDBM50143069 OC(=O)CC[C@H](NC(=O)N[C@@H](Cc1ccccc1)C(O)=O)C(O)=O
BDBM50143070 OC(=O)CC[C@H](NC(=O)N[C@@H](CCc1nnnn1CCC#N)C(O)=O)C(O)=O
BDBM50143071 OC(=O)CC[C@H](NC(=O)N[C@@H](CCC(O)=O)c1nnnn1CCC#N)c1nnnn1CCC#N
BDBM50143072 C[C@@](CCC(O)=O)(NC(=O)N[C@@](C)(CCC(O)=O)C(O)=O)C(O)=O
BDBM50143073 OC(=O)CC[C@H](NC(=O)N[C@@H](CCc1nnn[nH]1)C(O)=O)C(O)=O
BDBM50143074 OC(=O)CC[C@H](NC(=O)N[C@H](C(O)=O)c1ccccc1)C(O)=O
BDBM50143075 OC(=O)[C@@H](C[C@H](NC(=O)N[C@@H](C[C@H](Cc1ccccc1)C(O)=O)C(O)=O)C(O)=O)Cc1ccccc1
BDBM50143077 OC(=O)CC[C@H](NC(=O)N[C@@H](CCC(O)=O)c1nnn[nH]1)C(O)=O
BDBM50143078 OC(=O)CC[C@H](NC(=O)N[C@@H](Cc1ccc(O)cc1)C(O)=O)C(O)=O
BDBM50143079 OC(=O)[C@H](CCc1nnnn1CCC#N)NC(=O)N[C@@H](CCc1nnnn1CCC#N)C(O)=O
BDBM50143080 OC(=O)CC[C@H](NC(=O)N[C@H](C(O)=O)c1ccc(O)cc1)C(O)=O
BDBM50398813 C[C@@H](C[C@H](NC(=O)N[C@@H](C[C@H](C)C(O)=O)C(O)=O)C(O)=O)C(O)=O
BDBM50398814 C[C@H](C[C@H](NC(=O)N[C@@H](C[C@@H](C)C(O)=O)C(O)=O)C(O)=O)C(O)=O