BindingDB logo
myBDB logout

3 SMILES Strings for NACHT, LRR and PYD domains-containing protein 3

Compound NameSMILES String
BDBM50155926 CC(C)(O)c1coc(c1)S(=O)(=O)NC(=O)Nc1c2CCCc2cc2CCCc12
BDBM50155928 [O-][N+](=O)\C=C\c1ccc2OCOc2c1
BDBM50155930 [H][C@]12O[C@@]11[C@@](C)(CC[C@]3([H])[C@@]4(C)C=CC(=O)C(C)(C)[C@]4([H])C=C[C@@]13C)[C@@H](OC2=O)c1ccoc1 |r,c:13,23|