BindingDB logo
myBDB logout

4 SMILES Strings for NAD synthetase

Compound NameSMILES String
BDBM92597 C[N+](C)(C)c1ccc(CC(=O)OCCCCCCCCn2ccc3cc(OCc4ccccc4)ccc23)cc1
BDBM92598 COC(=O)c1cc2cc(OCc3ccccc3)ccc2n1CCCCCCCOC(=O)Cc1ccc[n+](C)c1
BDBM92599 COC(=O)c1cc2cc(OCc3ccccc3)ccc2n1CCCCCCCOC(=O)Cc1ccc(cc1)[N+](C)(C)C
BDBM92600 COC(=O)c1cc2ccccc2n1CCCCCCCCCOC(=O)Cc1ccc(cc1)[N+](C)(C)C