BindingDB logo
myBDB logout

20 SMILES Strings for NAD-dependent deacetylase sirtuin 3

Compound NameSMILES String
BDBM29040 Oc1ccc2ccccc2c1Cc1c([nH]c(=S)[nH]c1=O)-c1ccccc1
BDBM99917 CN(C)CCCCC(=O)Nc1ccc(NC(=S)NC(=O)c2ccc(cc2)C(C)(C)C)cc1
BDBM50297159 NC(=O)c1ccccc1Nc1ccccc1
BDBM50309827 CC(C(=O)Nc1cccc(c1)\N=C\c1c(O)ccc2ccccc12)c1ccccc1
BDBM50197506 CCCC[C@@H]1NC(=O)CCCCCCC(=O)NC[C@H](NC(=O)[C@H](CCCCNC(C)=S)NC1=O)C(N)=O |r|
BDBM50197508 CCCC[C@@H]1NC(=O)CCCCCCC(=O)NCCCC[C@H](NC(=O)[C@H](CCCCNC(C)=S)NC1=O)C(N)=O |r|
BDBM50209631 CC(=O)NCCCC[C@H](NC(=O)[C@H](CCCCNC(=O)CI)NC(=O)[C@H](CCCCNC(C)=O)NC(C)=O)C(N)=O |r|
BDBM50209638 CC(=O)NCCCC[C@H](NC(=O)[C@H](CCCCNC(=O)CCCCCSc1nc2ccccc2s1)NC(=O)[C@H](CCCCNC(C)=O)NC(C)=O)C(N)=O |r|
BDBM50197388 CC(=S)NCCCC[C@@H]1NC(=O)CNC(=O)CCCCCCC(=O)NCCCC[C@H](NC1=O)C(N)=O |r|
BDBM50197389 CC(=S)NCCCC[C@@H]1NC(=O)[C@H](Cc2csc3ccccc23)NC(=O)CCCCCCC(=O)NCCC[C@H](NC1=O)C(N)=O |r|
BDBM50197390 CC(=S)NCCCC[C@@H]1NC(=O)[C@H](Cc2ccc3ccccc3c2)NC(=O)CCCCCCC(=O)NCC[C@H](NC1=O)C(N)=O |r|
BDBM50197392 CC(=S)NCCCC[C@@H]1NC(=O)[C@H](Cc2ccc3ccccc3c2)NC(=O)CCCCCCC(=O)NCCCC[C@H](NC1=O)C(N)=O |r|
BDBM50197509 CC(=S)NCCCC[C@@H]1NC(=O)[C@H](Cc2ccc3ccccc3c2)NC(=O)CCCCCCC(=O)NCCC[C@H](NC1=O)C(N)=O |r|
BDBM50197510 CCCC[C@@H]1NC(=O)CCCCCCC(=O)NCC[C@H](NC(=O)[C@H](CCCCNC(C)=S)NC1=O)C(N)=O |r|
BDBM50197511 CC(=S)NCCCC[C@@H]1NC(=O)CNCCC(=O)NCCCC[C@H](NC1=O)C(N)=O |r|
BDBM50197423 CC(=S)NCCCC[C@@H]1NC(=O)[C@H](Cc2csc3ccccc23)NC(=O)CCCCCCC(=O)NCCCC[C@H](NC1=O)C(N)=O |r|
BDBM50197391 CC(=S)NCCCC[C@@H]1NC(=O)[C@H](Cc2csc3ccccc23)NC(=O)CCCCCCC(=O)NC[C@H](NC1=O)C(N)=O |r|
BDBM50197512 CCCC[C@@H]1NC(=O)CCCCCCC(=O)NCCC[C@H](NC(=O)[C@H](CCCCNC(C)=S)NC1=O)C(N)=O |r|
BDBM50197514 CC(=S)NCCCC[C@@H]1NC(=O)[C@H](Cc2csc3ccccc23)NC(=O)CCCCCCC(=O)NCC[C@H](NC1=O)C(N)=O |r|
BDBM50197515 CC(=S)NCCCC[C@@H]1NC(=O)[C@H](Cc2ccc3ccccc3c2)NC(=O)CCCCCCC(=O)NC[C@H](NC1=O)C(N)=O |r|