BindingDB logo
myBDB logout

4 SMILES Strings for NAD-dependent protein deacetylase sirtuin-7 (SIRT7)

Compound NameSMILES String
BDBM234205 CC(=S)NCCCCC(NC(=O)Oc1ccccc1)C(=O)Nc1ccccc1
BDBM234206 CCCC(=S)NCCCCC(NC(=O)Oc1ccccc1)C(=O)Nc1ccccc1
BDBM234207 CCCCCCC(=S)NCCCCC(NC(=O)Oc1ccccc1)C(=O)Nc1ccccc1
BDBM234208 CCCCCCCCCCCCCC(=S)NCCCCC(NC(=O)Oc1ccccc1)C(=O)Nc1ccccc1