BindingDB logo
myBDB logout

55 SMILES Strings for NADH dehydrogenase [ubiquinone] flavoprotein 1, mitochondrial

Compound NameSMILES String
BDBM263604 CC(C)(C)n1ncc(OCc2ccc(COCCF)cc2)c(Cl)c1=O
BDBM263606 CC(C)n1ncc(OCc2ccc(COCCF)cc2)c(Cl)c1=O
BDBM263607 CC(C)(C)n1ncc(OCc2ccc(OCCCF)nc2)c(Cl)c1=O
BDBM263609 Cn1ncc(OCc2ccc(COCCF)cc2)c(Cl)c1=O
BDBM263610 Cc1c(OCc2ccc(COCCF)cc2)cnn(c1=O)C(C)(C)C
BDBM263611 FCCOCc1ccc(COc2cnn(-c3ccccc3)c(=O)c2Cl)cc1
BDBM263612 CC(C)(C)n1ncc(OCc2ccc(cc2)C#CCCF)c(Cl)c1=O
BDBM263630 CC(C)(C)n1ncc(OCc2ccc(CNCCF)cc2)c(Cl)c1=O
BDBM263631 CC(C)(C)n1ncc(\C=C\c2ccc(COCCF)cc2)c(Cl)c1=O
BDBM263662 CC(C)[Si](F)(C(C)C)c1ccc(COc2cnn(c(=O)c2Cl)C(C)(C)C)cc1
BDBM263632 CC(C)(C)n1ncc(OCc2ccc(CF)cc2)c(Cl)c1=O
BDBM263613 FCCOCc1ccc(COc2cnn(C3CCCCC3)c(=O)c2Cl)cc1
BDBM263615 CC(C)(C)n1ncc(OCc2ccc(COCCF)cc2)cc1=O
BDBM263616 CC(C)(C)n1ncc(OCc2ccc(cc2)-c2ccc(OCCCF)cc2)c(Cl)c1=O
BDBM263614 CC(C)(C)n1ncc(OCc2ccc(cc2)C(=O)OCCF)c(Cl)c1=O
BDBM263619 CC(C)(C)n1ncc(OCCC#Cc2ccc(CF)cc2)c(Cl)c1=O
BDBM263620 CC(C)c1c(OCc2ccc(COCCF)cc2)cnn(c1=O)C(C)(C)C
BDBM263618 CC(C)(C)n1ncc(OCc2ccc(COCCF)cc2)c(Br)c1=O
BDBM263605 CC(C)(C)n1ncc(OCc2ccc(COCCOC(=O)CC#N)cc2)c(Cl)c1=O
BDBM263621 CC(C)(C)n1ncc(OCc2cc(Cl)c(OCCCF)c(Cl)c2Cl)c(Cl)c1=O
BDBM263623 CC(C)(C)n1ncc(c(Cl)c1=O)-c1ccc(COCCF)cc1
BDBM263633 CC(C)(C)n1ncc(CCc2ccc(COCCF)cc2)c(Cl)c1=O
BDBM263635 CC(C)(C)n1ncc(OCc2ccc(cc2)-c2ccc(F)cc2)c(Cl)c1=O
BDBM263636 CC(C)(C)n1ncc(OCc2ccc(cc2)-c2cnc(Cl)nc2)c(Cl)c1=O
BDBM263637 CC(C)(C)n1ncc(OCc2ccc(COCCF)cn2)c(Cl)c1=O
BDBM263625 CC(C)(C)n1ncc(Oc2ccc(CCCF)cc2)c(Cl)c1=O
BDBM263626 CC(OCCF)c1ccc(COc2cnn(c(=O)c2Cl)C(C)(C)C)cc1
BDBM263624 CC(C)(C)n1ncc(OCc2ccc(OCCOCCF)cc2)c(Cl)c1=O
BDBM263638 CC(C)(C)n1ncc(OCc2ccc(cc2)-c2cnc(F)nc2)c(Cl)c1=O
BDBM263639 CC(C)(C)n1ncc(OCc2ccc(COCCF)c(Br)c2)c(Cl)c1=O
BDBM263640 CC(C)(C)n1ncc(Oc2cccnc2[N+]([O-])=O)c(Cl)c1=O
BDBM263641 Cc1cc(COc2cnn(c(=O)c2Cl)C(C)(C)C)c(C)cc1COCCF
BDBM263642 CC(C)(C)n1ncc(Oc2cccnc2F)c(Cl)c1=O
BDBM263643 CC(C)(C)n1ncc(OCc2ccc(OCCCF)c(Cl)c2)c(Cl)c1=O
BDBM263644 CC(C)(C)n1ncc(OCc2ccc(Oc3cccnc3[N+]([O-])=O)cc2)c(Cl)c1=O
BDBM263645 CC(C)(C)n1ncc(OCc2cc(Cl)c(OCCCF)c(Cl)c2)c(Cl)c1=O
BDBM263628 CC(C)(C)n1ncc(OCc2ccc(COCCOCCCF)cc2)c(Cl)c1=O
BDBM263629 CC(C)(C)n1ncc(OCc2ccc(cc2)-c2ccc(F)nc2)c(Cl)c1=O
BDBM263627 CC(C)(C)n1ncc(OCc2ccc(cc2)-c2ccc(nc2)[N+]([O-])=O)c(Cl)c1=O
BDBM263646 CC(C)(C)n1ncc(OCc2ccc(Oc3cccnc3F)cc2)c(Cl)c1=O
BDBM263647 COc1cc(COc2cnn(c(=O)c2Cl)C(C)(C)C)cc(Br)c1OCCCF
BDBM263648 CC(C)(C)n1ncc(OCc2ccc(cc2)C(=O)OCCCF)c(Cl)c1=O
BDBM263649 CC(C)(C)n1ncc(OCc2ccc(OCCCF)cc2Cl)c(Cl)c1=O
BDBM263650 CC(C)(C)n1ncc(OCc2ccc(cc2)C(C)(C)O)c(Cl)c1=O
BDBM263651 COc1cc(COCCF)ccc1COc1cnn(c(=O)c1Cl)C(C)(C)C
BDBM263652 CC(C)(C)n1ncc(OCc2ccc(cc2)C(C)(C)OCCF)c(Cl)c1=O
BDBM263653 CC(C)(C)n1ncc(OCc2cccc(OCCCF)c2)c(Cl)c1=O
BDBM263654 CC(C)(C)n1ncc(C#Cc2ccc(COCCF)cc2)c(Cl)c1=O
BDBM263655 CC(C)(C)n1ncc(OCc2cccc(OCCF)c2)c(Cl)c1=O
BDBM263656 CC(C)(C)[SiH](c1ccc(COc2cnn(c(=O)c2Cl)C(C)(C)C)cc1)C(C)(C)C
BDBM263657 CC(C)(C)n1ncc(OCc2cccc(COCCF)c2)c(Cl)c1=O
BDBM263658 CC(C)(C)n1ncc(OCc2ccc(cc2)[Si](F)(C(C)(C)C)C(C)(C)C)c(Cl)c1=O
BDBM263659 Cc1ccc(cc1)S(=O)(=O)OCCOCc1cccc(COc2cnn(c(=O)c2Cl)C(C)(C)C)c1
BDBM263660 CC(C)[SiH](C(C)C)c1ccc(COc2cnn(c(=O)c2Cl)C(C)(C)C)cc1
BDBM263661 COC(=O)OCCOCc1ccc(COc2cnn(c(=O)c2Cl)C(C)(C)C)cc1