BindingDB logo
myBDB logout

2 SMILES Strings for NADH-ubiquinone oxidoreductase MLRQ subunit

Compound NameSMILES String
BDBM50172374 COc1cc(CC(=C)c2ccc3OC(C)(C)CCc3c2)cc(OC)c1OC
BDBM50172381 COc1cc(COC(=O)c2ccc3OC(C)(C)C=Cc3c2)cc(OC)c1OC |c:17|