BindingDB logo
myBDB logout

4 SMILES Strings for NADP-dependent leukotriene B4 12-hydroxydehydrogenase

Compound NameSMILES String
BDBM50410832 CC1=CC2=C(C)C3(CC3)[C@](C)(O)C(=O)C2=C1 |c:3,16,t:1|
BDBM50410833 CC1=CC2=C(C)[C@]3(CC3)[C@@](C)(O)C(=O)C2=C1 |r,c:3,16,t:1|
BDBM50410834 CC1=C(CO)C2=C(C)C3(CC3)[C@](C)(O)C(=O)C2=C1 |c:1,5,18|
BDBM50410835 CC1=C(CO)C2=C(C)C3(CC3)[C@@](C)(O)C(=O)C2=C1 |r,c:1,5,18|