BindingDB logo
myBDB logout

11 SMILES Strings for NADP-dependent malic enzyme

Compound NameSMILES String
BDBM50177175 Oc1ccc(cc1)N1CCN(CC1)C1CC(=O)N(Cc2ccccc2)C1=O
BDBM50177176 Oc1ccccc1N1CCN(CC1)C1CC(=O)N(Cc2ccccc2)C1=O
BDBM50177177 Oc1cc(N2CCN(CC2)c2cccc(c2)C(F)(F)F)c(O)n1-c1ccccc1
BDBM50177178 Oc1cccc(c1)N1CCN(CC1)C1CC(=O)N(Cc2ccccc2)C1=O
BDBM50177179 Oc1cc(N2CCN(CC2)c2ccc(F)cc2)c(O)n1-c1ccccc1
BDBM50177180 Oc1cc(N2CCN(CC2)c2ccc(O)cc2)c(O)n1-c1ccccc1
BDBM50177181 COc1ccc(cc1)N1CCN(CC1)c1cc(O)n(c1O)-c1ccccc1
BDBM50177182 COc1ccc(cc1)N1CCN(CC1)C1CC(=O)N(Cc2ccccc2)C1=O
BDBM50177183 COc1ccc(cc1)N1CCN(CC1)c1cc(O)n(c1O)-c1cccc(Cl)c1Cl |(11.94,-5.56,;11.17,-4.23,;9.63,-4.23,;8.86,-2.9,;7.32,-2.9,;6.55,-4.23,;7.32,-5.56,;8.86,-5.56,;5.01,-4.23,;4.24,-2.9,;2.7,-2.9,;1.93,-4.23,;2.7,-5.56,;4.24,-5.56,;.39,-4.23,;-.51,-5.48,;-1.98,-5,;-3.23,-5.91,;-1.98,-3.46,;-.51,-2.98,;-.04,-1.52,;-3.23,-2.56,;-3.06,-1.02,;-4.31,-.12,;-5.71,-.75,;-5.88,-2.28,;-7.28,-2.91,;-4.63,-3.18,;-4.79,-4.72,)|
BDBM50177184 Cc1ccc(cc1Cl)-n1c(O)cc(N2CCN(CC2)c2ccc(O)cc2)c1O
BDBM50338502 COc1ccc(cc1)-c1cn(nn1)[C@@H]1O[C@H](COP(O)(O)=O)[C@@H](O)[C@H]1O |r|