BindingDB logo
myBDB logout

40 SMILES Strings for NADPH-dependent enoyl-ACP reductase (FabI)

Compound NameSMILES String
BDBM112624 CCc1cc(OC(=O)OC)c(Oc2ccc(cc2F)C(=O)N2CCNC(=O)C2)cc1F
BDBM190652 CCCCCCc1ccn(Cc2ccccc2C)c(=O)c1
BDBM50399404 CCc1cc(O)c(Oc2ccc(cc2F)C(=O)N2CCNC(=O)C2)cc1F
BDBM50399405 CCc1ccc(Oc2ccc(cc2F)C(=O)N2CCNC(=O)C2)c(O)c1
BDBM9913 NC(=O)C1Cc2cc(\C=C\C(=O)N3CCC(COc4ccc(F)cc4)CC3)cnc2NC1=O
BDBM133657 O=C(\C=C\c1cnc2NC(=O)CCc2c1)N1CCC1
BDBM133658 O=C(\C=C\c1cnc2NC(=O)CCc2c1)N1CCCC1
BDBM133659 O=C(\C=C\c1cnc2NC(=O)CCc2c1)N1CCCCC1
BDBM133660 OCCC1CCN(CC1)C(=O)\C=C\c1cnc2NC(=O)CCc2c1
BDBM133661 CC(C)(C)OC(=O)N1CCC(COc2ccc(F)cc2)CC1
BDBM133663 O=C(\C=C\c1cnc2NC(=O)CCc2c1)N1CCCC1c1ccccc1
BDBM133664 CCCC1CCN(CC1)C(=O)\C=C\c1cnc2NC(=O)CCc2c1
BDBM133666 O=C(\C=C\c1cnc2NC(=O)CCc2c1)N1CCC(C1)Oc1ccccc1
BDBM133668 O=C(\C=C\c1cnc2NC(=O)CCc2c1)N1CC(C1)OCc1cccs1
BDBM133669 Cc1nc(no1)C1CCCCN1C(=O)\C=C\c1cnc2NC(=O)CCc2c1
BDBM133670 OC1(CCN(CC1)C(=O)\C=C\c1cnc2NC(=O)CCc2c1)c1ccccc1
BDBM133671 CCCCCOC1CN(C1)C(=O)\C=C\c1cnc2NC(=O)CCc2c1
BDBM133672 O=C(\C=C\c1cnc2NC(=O)CCc2c1)N1CCC(C1)Oc1cccnc1
BDBM133673 O=C(\C=C\c1cnc2NC(=O)CCc2c1)N1CC(C1)OCc1ccccc1
BDBM133674 O=C(\C=C\c1cnc2NC(=O)CCc2c1)N1CCCC[C@@H]1c1nc2ccccc2o1 |r|
BDBM133675 CC(=C)COC1CN(C1)C(=O)\C=C\c1cnc2NC(=O)CCc2c1
BDBM133676 O=C(\C=C\c1cnc2NC(=O)CCc2c1)N1CC(C1)OCc1nccs1
BDBM133677 C\C(Cc1ncccn1)=N/OC1CN(C1)C(=O)\C=C\c1cnc2NC(=O)CCc2c1 |w:10.10|
BDBM133678 CCCCCS(=O)(=O)C1CN(C1)C(=O)\C=C\c1cnc2NC(=O)CCc2c1
BDBM133679 Nc1ccc(\C=C\C(=O)N2CC(C2)OCc2ccncc2)cn1
BDBM133680 CC(=O)Nc1ccc(\C=C\C(=O)N2CC(C2)OCc2ccncc2)cn1
BDBM133683 OCC1Cc2cc(\C=C\C(=O)N3CCC(COc4ccc(F)cc4)CC3)cnc2NC1=O
BDBM133681 COC(=O)C1Cc2cc(\C=C\C(=O)N3CCC(COc4ccc(F)cc4)CC3)cnc2NC1=O
BDBM162329 O=C(\C=C\c1cnc2NC(=O)CCc2c1)N1CC(C1)Oc1ccccc1
BDBM162330 Fc1ccc(OCC2CCCN(C2)C(=O)\C=C\c2cnc3NC(=O)CCc3c2)cc1
BDBM162339 Cc1nc(no1)C1CN(C1)C(=O)\C=C\c1cnc2NC(=O)CCc2c1
BDBM190653 CCCCCCc1ccn(Cc2ccccc2Cl)c(=O)c1
BDBM190654 CCCCCCc1ccn(Cc2cccc(N)c2C)c(=O)c1
BDBM190655 CCCCCCc1ccn(Cc2ccccc2)c(=O)c1
BDBM190661 CCCCCCc1cc(=O)c(Oc2ccccc2C)cn1C
BDBM231620 Cc1c(N)cccc1Cn1ccc(OCCc2cccs2)cc1=O
BDBM231621 CCCCCc1ccn(Cc2ccccc2C#N)c(=O)c1
BDBM231622 Cc1ccn(Cc2ccccc2Cl)c(=O)c1
BDBM231623 CCCCCCc1cc(=O)c(Cc2ccccc2C#N)cn1C
BDBM231624 CCCCCCc1ccc(Oc2ccccc2)c(=O)[nH]1