BindingDB logo
myBDB logout

4 SMILES Strings for NEDD8-activating enzyme E1 regulatory subunit

Compound NameSMILES String
BDBM50427031 OC(=O)CNC(=O)CNC(=O)COc1ccc2nc3CCCn3c(=O)c2c1
BDBM50427032 Oc1ccc(cc1)-c1cc(O)c2c(cc(O)c(-c3c(O)cc4oc(cc(=O)c4c3O)-c3ccc(O)cc3)c2=O)o1 |(1,-46.28,;2.34,-47.05,;2.34,-48.59,;3.67,-49.36,;5.01,-48.59,;5,-47.04,;3.67,-46.28,;6.34,-49.36,;6.35,-50.9,;7.67,-51.67,;7.67,-53.21,;9.01,-50.9,;9.01,-49.36,;10.33,-48.59,;11.66,-49.35,;12.99,-48.58,;11.66,-50.89,;13,-51.66,;12.99,-53.2,;11.66,-53.97,;14.33,-53.97,;15.66,-53.19,;16.99,-53.96,;18.32,-53.19,;18.32,-51.65,;16.98,-50.87,;16.98,-49.33,;15.65,-51.65,;14.32,-50.89,;14.31,-49.35,;19.65,-53.96,;19.65,-55.5,;20.98,-56.27,;22.32,-55.5,;23.65,-56.27,;22.31,-53.95,;20.98,-53.19,;10.34,-51.66,;10.34,-53.2,;7.68,-48.58,)|
BDBM50427034 NS(=O)(=O)OC[C@@H]1C[C@H](C[C@@H]1O)N1CCc2c1ncnc2N[C@H]1CCc2ccccc12 |r|
BDBM50427035 NS(=O)(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)n1cnc2c(N[C@H]3CCc4ccccc34)ncnc12 |r|