BindingDB logo
myBDB logout

1 SMILES String for Na(+)/H(+) antiporter nhaA

Compound NameSMILES String
BDBM50010751 Nc1nc2cccc3cccc([nH]1)c23