BindingDB logo
myBDB logout

46 SMILES Strings for Na/K-ATPase

Compound NameSMILES String
BDBM50000186 COc1c(OCC(F)(F)C(F)(F)C(F)(F)C(F)F)ccnc1CS(=O)c1nc2cscc2[nH]1
BDBM50000199 COc1c(OCC(F)(F)C(F)F)ccnc1CS(=O)c1nc2cscc2[nH]1
BDBM50000211 Cc1sc(C)c2[nH]c(nc12)S(=O)Cc1cc(OCC(F)(F)F)ccn1
BDBM50000222 COc1c(OCC(F)(F)F)ccnc1CS(=O)c1nc2cscc2[nH]1
BDBM50000227 Fc1ccc(COc2ccnc(CS(=O)c3nc4cscc4[nH]3)c2)cc1
BDBM50000237 COc1c(OCC(F)(F)C(F)(F)C(F)(F)F)ccnc1CS(=O)c1nc2cscc2[nH]1
BDBM50000259 FC(F)C(F)(F)C(F)(F)C(F)(F)COc1ccnc(CS(=O)c2nc3cscc3[nH]2)c1
BDBM50000672 COc1cccc2c3n(ccc3c(C)nc12)-c1ccccc1C
BDBM50000685 Cc1ccccc1N1CCc2cnc3c(C)cccc3c12
BDBM50001247 CCOC(=O)c1cnc2c(OC)cccc2c1Nc1ccccc1C
BDBM50008977 Cc1nc2c(OCc3ccccc3)cccn2c1CC#N
BDBM50013225 COc1cccc2c3N(Cc4ccccc4)CCc3c(C)nc12
BDBM50013226 COc1cccc2c3N(CCc3c(C)nc12)c1ccccc1
BDBM50013227 COc1cccc2c3N(CCCc3cnc12)c1ccccc1C
BDBM50013228 COc1cccc2c3N(CCc3c(C)nc12)c1ccccc1C
BDBM50013229 COc1cccc2[c+]3N(CCc3c(C)n(C)c12)c1ccccc1C
BDBM50013230 COc1ccc(N2CCc3c2c2cccc(OC)c2nc3C)c(C)c1
BDBM50013231 Cc1ccccc1N1CCc2c1c1cccc(F)c1nc2C
BDBM50013233 Cc1ccccc1N1CCc2c1c1cccc(O)c1nc2C
BDBM50013234 COc1ccccc1N1CCc2c1c1cccc(OC)c1nc2C
BDBM50013235 Cc1ccccc1-n1cnc2cnc3ccccc3c12
BDBM50013236 COc1ccc(N2CCc3c2c2ccccc2nc3C)c(C)c1
BDBM50013237 Cc1cc(O)ccc1N1CCc2c1c1ccccc1nc2C
BDBM50013238 Cc1ccccc1-n1c2c(cnc3ccccc23)[nH]c1=S |(3.97,1.52,;2.64,.75,;1.31,1.52,;-.04,.74,;-.02,-.8,;1.33,-1.57,;2.66,-.79,;4,-1.55,;3.67,-3.06,;5,-3.83,;5,-5.37,;3.67,-6.14,;2.34,-5.37,;1.01,-6.14,;-.33,-5.37,;-.33,-3.83,;1.01,-3.06,;2.34,-3.83,;6.16,-2.78,;5.51,-1.4,;6.61,-.29,)|
BDBM50013239 Cc1cccc(C)c1N1CCc2c1c1ccccc1nc2C
BDBM50013240 Cc1ccccc1N1CCc2c1c1cccc(C)c1nc2C
BDBM50013241 Cc1ccccc1-n1nnc2cnc3ccccc3c12
BDBM50013242 Cc1ccccc1N1CCc2c1c1ccccc1[n+]([O-])c2C
BDBM50013243 Cc1ccccc1N1CCc2c1c1ccccc1nc2C
BDBM50155436 Oc1cc(O)c2c(c1)oc1c(O)cccc1c2=O
BDBM50269645 Oc1ccc2c(oc3ccccc3c2=O)c1O
BDBM50292547 Oc1cc(O)c2c(c1)oc1c(O)c(O)ccc1c2=O
BDBM50292546 Oc1ccc2c(oc3c(O)c(O)ccc3c2=O)c1O
BDBM50286570 Cc1ccccc1-c1sc(Cc2ccccc2)nc1-c1ccccn1
BDBM50286571 Cc1ccccc1-c1nc(c(s1)-c1ccccc1C)-c1ccccn1
BDBM50286572 CCCc1nc(c(s1)-c1ccccc1C)-c1ccccn1
BDBM50286573 CCCc1nc(c(s1)-c1ccccc1C)-c1cccc(NC)n1
BDBM50286575 CCCc1nc(c(s1)-c1ccccc1C)-c1cc(N)ccn1
BDBM50286576 CCCc1nc(c(s1)-c1ccccc1C)-c1cccc(N)n1
BDBM50286574 CCCc1nc(c(s1)-c1ccccc1)-c1ccccn1
BDBM174832 Oc1cc(O)c2c(c1)oc1ccccc1c2=O
BDBM174833 Oc1ccc2c(oc3c(O)cccc3c2=O)c1O
BDBM174834 COc1ccc2c(c1)oc1c(OC)c(OC)ccc1c2=O
BDBM174835 COc1cc(O)c2c(c1)oc1ccc(O)c(OC)c1c2=O
BDBM174836 COc1cc(O)c2c(c1)oc1ccc(OC)c(O)c1c2=O
BDBM174837 COc1ccc2oc3cc(OC)c(OC)c(OC)c3c(=O)c2c1