BindingDB logo
myBDB logout

2 SMILES Strings for Neural Wiskott-Aldrich syndrome protein

Compound NameSMILES String
BDBM50154292 CN(C)C[C@H](O)Cn1c2ccc(Br)cc2c2cc(Br)ccc12 |r|
BDBM50154293 CN(C)C[C@@H](O)Cn1c2ccc(Br)cc2c2cc(Br)ccc12 |r|