BindingDB logo
myBDB logout

1 SMILES String for Neuraminidase B (NanB)

Compound NameSMILES String
BDBM4706 CC(=O)N[C@@H]1[C@@H](O)C=C(O[C@H]1[C@H](O)[C@H](O)CO)C(O)=O |r,c:7|