BindingDB logo
myBDB logout

1 SMILES String for Neuraminidase N1

Compound NameSMILES String
BDBM5025 [H][C@@]1(OC(CC)CC)C=C(C[C@H](N)[C@H]1NC(C)=O)C(=O)OCC |r,c:8|