BindingDB logo
myBDB logout

1 SMILES String for Neurogenic locus notch homolog protein 4

Compound NameSMILES String
BDBM50074694 CN1c2ccccc2C(=N[C@H](NC(=O)[C@H](CCC(F)(F)F)[C@@H](C(N)=O)c2ccccc2)C1=O)c1ccccc1 |r,c:9|