BindingDB logo
myBDB logout

16 SMILES Strings for Neuromedin B

Compound NameSMILES String
BDBM86498 CCCC[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)C[C@@H](NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](N)Cc1ccc(O)cc1)C(C)C)c1cccc(Cl)c1)C(N)=O |r|
BDBM86499 CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)CNC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H]1CCC(=O)N1)C(C)C)C(N)=O |r,wU:53.61,34.35,8.12,82.92,wD:39.52,30.31,62.69,16.23,74.81,4.4,93.101,102.104,(26.12,-4.99,;27.44,-4.18,;27.44,-2.62,;26.09,-1.86,;26.09,-.32,;24.73,.42,;23.38,-.32,;23.4,-1.88,;22.06,.39,;22.03,1.92,;23.36,2.71,;24.73,1.95,;23.33,4.29,;20.69,-.35,;19.37,.37,;19.34,1.9,;18.02,-.37,;18.02,-1.92,;19.39,-2.69,;20.78,-2.04,;21.85,-3.22,;21.08,-4.57,;19.55,-4.2,;16.68,.35,;15.33,-.39,;15.35,-1.92,;13.99,.32,;12.66,-.42,;11.3,.3,;11.27,1.86,;9.97,-.44,;8.63,.28,;7.26,-.46,;7.28,-1.99,;5.94,.25,;5.94,1.81,;4.59,-.49,;3.27,.25,;3.27,1.79,;1.95,-.49,;1.97,-2.02,;3.27,-2.78,;4.57,-1.97,;5.78,-2.95,;5.22,-4.38,;5.94,-5.78,;5.08,-7.1,;3.53,-7.03,;2.81,-5.61,;3.66,-4.27,;.58,.23,;-.7,-.51,;-.7,-2.06,;-2.06,.21,;-2.06,1.76,;-.74,2.55,;-.74,4.13,;.53,4.92,;-2.11,4.89,;-3.39,-.53,;-4.71,.19,;-4.73,1.72,;-6.05,-.56,;-6.05,-2.09,;-4.69,-2.88,;-3.36,-2.06,;-4.66,-4.43,;-7.42,.16,;-8.77,-.58,;-8.74,-2.11,;-10.11,.14,;-11.41,-.63,;-12.78,.12,;-12.8,1.65,;-14.1,-.65,;-14.08,-2.18,;-12.76,-2.95,;-11.41,-2.16,;-12.73,-4.52,;-15.47,.12,;-16.82,-.67,;-16.79,-2.23,;-18.14,.09,;-18.16,1.6,;-16.84,2.39,;-16.86,3.94,;-15.49,4.75,;-15.52,6.31,;-16.89,7.07,;-14.15,7.1,;-19.48,-.7,;-20.83,.07,;-20.83,1.58,;-22.17,-.72,;-22.15,-2.27,;-20.81,-3.04,;-20.81,-4.62,;-19.44,-5.36,;-22.13,-5.38,;-23.54,.05,;-24.89,-.74,;-24.89,-2.3,;-26.21,.02,;-25.24,-1.09,;-25.96,-2.57,;-27.46,-2.25,;-28.76,-3.04,;-27.46,-.74,;9.97,-1.97,;11.32,-2.76,;8.65,-2.76,;27.42,.42,;28.76,-.3,;27.39,1.97,)|
BDBM86500 CC(C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](N)Cc1ccc(O)cc1)C(=O)NCCC(=O)N[C@@H](Cc1cnc[nH]1)C(=O)N[C@@H](Cc1ccccc1)C(=O)NCC(N)C(N)=O |r|
BDBM86501 CCCC[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)C[C@H](NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](N)Cc1ccc(O)cc1)C(C)C)c1cccc(Cl)c1)C(N)=O |r|
BDBM86502 CCCC[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)CCNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](N)Cc1ccc(O)cc1)C(C)C)C(N)=O |r|
BDBM86503 CCCC[C@H](NC(=O)[C@H](Cc1ccccc1)N[N+](=N)[C@H](Cc1cnc[nH]1)NC(=O)C(N)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](N)Cc1ccc(O)cc1)C(C)C)C(N)=O |r|
BDBM86504 CCCC[C@H](NC(=O)[C@H](Cc1ccccc1)N[N+](=N)[C@H](Cc1cnc[nH]1)NC(=O)C[C@@H](NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](N)Cc1ccc(O)cc1)C(C)C)c1ccccc1Cl)C(N)=O |r|
BDBM86505 CCCC[C@H](NC(=O)[C@H](Cc1ccccc1)N[N+](=N)[C@H](Cc1cnc[nH]1)NC(=O)C[C@@H](NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](N)Cc1ccc(O)cc1)C(C)C)c1ccc(Cl)cc1)C(N)=O |r|
BDBM86506 CCCC[C@H](NC(=O)[C@H](Cc1ccccc1)N[N+](=N)[C@H](Cc1cnc[nH]1)NC(=O)C[C@H](NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](N)Cc1ccc(O)cc1)C(C)C)c1ccccc1Cl)C(N)=O |r|
BDBM86507 CCCC[C@H](NC(=O)[C@H](Cc1ccccc1)N[N+](=N)[C@H](Cc1cnc[nH]1)NC(=O)C[C@@H](NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](N)Cc1ccc(O)cc1)C(C)C)C(O)=O)C(N)=O |r|
BDBM86508 CCCC[C@H](NC(=O)[C@H](Cc1ccccc1)N[N+](=N)[C@H](Cc1cnc[nH]1)NC(=O)C(CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](N)Cc1ccc(O)cc1)C(C)C)NC(C)=O)C(N)=O |r|
BDBM86509 CCCC[C@H](NC(=O)[C@H](Cc1ccccc1)N[N+](=N)[C@H](Cc1cnc[nH]1)NC(=O)C(CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](N)Cc1ccc(O)cc1)C(C)C)NC(=O)c1ccccc1)C(N)=O |r|
BDBM86510 CCCC[C@H](NC(=O)[C@H](Cc1ccccc1)N[N+](=N)[C@H](Cc1cnc[nH]1)NC(=O)C[C@H](NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](N)Cc1ccc(O)cc1)C(C)C)c1ccc(Cl)cc1)C(N)=O |r|
BDBM86511 CCCC[C@H](NC(=O)[C@H](Cc1ccccc1)N[N+](=N)[C@H](Cc1cnc[nH]1)NC(=O)C[C@@H](NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](N)Cc1ccc(O)cc1)C(C)C)C(=O)Nc1ccccc1)C(N)=O |r|
BDBM86512 CCCC[C@H](NC(=O)[C@H](Cc1ccccc1)N[N+](=N)[C@H](Cc1cnc[nH]1)NC(=O)C[C@@H](NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](N)Cc1ccc(O)cc1)C(C)C)c1ccccc1)C(N)=O |r|
BDBM50071745 CSCC[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(N)=O)NC(=O)CN)[C@@H](C)O)C(N)=O