BindingDB logo
myBDB logout

6 SMILES Strings for Neuromedin B receptor

Compound NameSMILES String
BDBM50071739 COc1ccc(nc1)C1(CNC(=O)[C@](C)(Cc2c[nH]c3ccccc23)NC(=O)Nc2ccc(cc2)[N+]([O-])=O)CCCCC1
BDBM50071754 CC(C)c1cccc(C(C)C)c1NC(=O)N[C@@](C)(Cc1c[nH]c2ccccc12)C(=O)NCC1(CCCCC1)c1ccccn1
BDBM50147019 COc1cccc2[nH]c3CCC(Cc3c12)(NC(=O)Nc1c(cccc1C(C)C)C(C)C)C(=O)NCC1(CCCCC1)c1ccccn1
BDBM50147021 CC(C)c1cccc(C(C)C)c1NC(=O)NC1(CCc2[nH]c3ccccc3c2C1)C(=O)NCC1(CCCCC1)c1ccccn1
BDBM50147036 CC(C)c1cccc(C(C)C)c1NC(=O)NC1(CCc2[nH]c3ccc(C)cc3c2C1C)C(=O)NCC1(CCCCC1)c1ccccn1
BDBM50289799 CC(C)CCNC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)OCc1cnc[nH]1