BindingDB logo
myBDB logout

2 SMILES Strings for Neuronal acetylcholine receptor subunit alpha-7

Compound NameSMILES String
BDBM50251047 Cc1cc(O)n(c1O)-c1ccccc1C(=O)OC[C@@H]1CCCN(CCCc2ccccc2)C1 |r,wU:18.19,(12.41,-11.72,;10.96,-12.25,;9.68,-11.39,;8.47,-12.34,;6.99,-11.91,;9,-13.78,;10.53,-13.73,;11.48,-14.95,;8.14,-15.06,;9.47,-15.82,;9.47,-17.37,;8.13,-18.14,;6.8,-17.36,;6.81,-15.82,;5.48,-15.05,;5.48,-13.51,;4.14,-15.81,;2.81,-15.04,;1.48,-15.8,;.15,-15.03,;-1.18,-15.8,;-1.18,-17.34,;.15,-18.11,;.15,-19.65,;1.48,-20.42,;2.81,-19.65,;4.15,-20.42,;4.14,-21.96,;5.47,-22.73,;6.81,-21.96,;6.8,-20.41,;5.47,-19.65,;1.48,-17.34,)|
BDBM50393245 O=C(N[C@@H]1CN2CCC1CC2)c1n[nH]c2ccccc12 |r,wD:3.2,(-1.66,-41.21,;-1.66,-39.67,;-2.99,-38.9,;-4.32,-39.66,;-4.33,-41.2,;-5.66,-41.96,;-6.98,-41.2,;-6.98,-39.66,;-5.66,-38.88,;-4.9,-40.21,;-6.39,-40.61,;-.32,-38.91,;1.09,-39.54,;2.12,-38.4,;1.36,-37.06,;1.84,-35.61,;.82,-34.46,;-.69,-34.78,;-1.17,-36.24,;-.15,-37.37,)|