BindingDB logo
myBDB logout

20 SMILES Strings for Neuronal acetylcholine receptor subunit beta-2

Compound NameSMILES String
BDBM50006629 [H][C@]12CCN3CCc4cc5OCOc5cc4[C@]13CCCC2 |r|
BDBM50006633 COc1cc2CCN3CCCC3c2cc1OC
BDBM50006635 COc1cc2C3CCCN3CCc2cc1O
BDBM50006639 COc1cc2CN(C)CCc2cc1O
BDBM50006642 CCCCC1N(C)CCc2cc(OC)c(OC)cc12
BDBM50006644 COc1cc2CCN(C)C(c3ccccc3)c2cc1OC
BDBM50006646 COc1ccc(cc1OC)C1N(C)CCc2cc(OC)c(OC)cc12
BDBM50006631 [H][C@]12CCN3CCc4cc(OC)c(O)cc4[C@]13CCCC2 |r|
BDBM50006632 Br.[H][C@]12CCN3CCc4cc(O)c(O)cc4[C@]13CCCC2 |r|
BDBM50006630 [H][C@]12CCN3CCc4cc(O)c(OC)cc4[C@]13CCCC2 |r|
BDBM50006634 C1CC2N(C1)CCc1cc3OCOc3cc21
BDBM50006636 COc1cc2CCN3CCCC3c2cc1O
BDBM50006637 Br.Oc1cc2CCN3CCCC3c2cc1O
BDBM50006640 COc1cc2CCN(C)Cc2cc1O
BDBM50006638 CN1CCc2cc3OCOc3cc2C1
BDBM50006641 CCC1N(C)CCc2cc(OC)c(OC)cc12
BDBM50006643 COc1cc2CCN(C)C(C3CCCCC3)c2cc1OC
BDBM50006645 COc1cccc(c1)C1N(C)CCc2cc(OC)c(OC)cc12
BDBM50014647 CN1CCc2cc(O)c(O)cc2C1
BDBM50014648 COc1cc2CCN(C)Cc2cc1OC